Feedback

N,N-dimethylglycine

PropertiesImageOccurences in reactions
MNX_IDMNXM464Image of MNXM464
#reac
in my sandbox 0
in MNXref (generic)21
in models (compartimentalized) 16
formulaC4H9NO2
charge0
mass103.06333
referencechebi:58251
InChIKeyFFDGPVCHZBVARC-UHFFFAOYSA-N
InChIInChI=1S/C4H9NO2/c1-5(2)3-4(6)7/h3H2,1-2H3,(H,6,7)
SMILESC[NH+](C)CC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58251
chebi:58251
N,N-dimethylglycine
(dimethylammonio)acetate
(dimethylazaniumyl)acetate
N,N-dimethylglycine zwitterion
hmdb:HMDB0000092 Dimethylglycine
(Dimethylamino)acetate
(Dimethylamino)acetic acid
2-(Dimethylamino)acetate
2-(Dimethylamino)acetic acid
2-(N,N-Dimethylamino)acetic acid
2-(dimethylamino)acetic acid
DMG
Dimethylglycine monohydrochloride
Dimethylglycine, calcium salt
Dimethylglycine, monopotassium salt
Dimethylglycine, sodium salt
N,N-Dimethylaminoacetate
N,N-Dimethylaminoacetic acid
N,N-Dimethylglycine
N-Methylsarcosine
N-Methylsarcosine N,N-dimethyl-glycine
dimethylglycine
seed.compound:cpd00756
seedM:cpd00756
Dimethylglycine
N,N-Dimethylglycine
N,N-dimethylglycine
dimethylglycine
dmgly
glycine, N,N-dimethyl-
bigg.metabolite:dmgly
biggM:dmgly
N,N-Dimethylglycine
sabiork.compound:5364
sabiorkM:5364
kegg.compound:C01026
keggC:C01026
N,N-Dimethylglycine
Dimethylglycine
reactome:R-ALL-1614585
reactomeM:R-ALL-1614585
CHEBI:17724
chebi:17724
N,N-dimethylglycine
(dimethylamino)acetic acid
2-(Dimethylamino)acetic acid
Dimethylglycine
N,N-DIMETHYLGLYCINE
N,N-Dimethylaminoacetic acid
N,N-Dimethylglycine
N-Methylsarcosine
metacyc.compound:DIMETHYL-GLYCINE
metacycM:DIMETHYL-GLYCINE
N,N-dimethylglycine
dimethylglycine
hmdb:HMDB00092
chebi:12426
chebi:14173
chebi:21455
chebi:41993
chebi:7077
biggM:M_dmgly
keggC:M_C01026
seedM:M_cpd00756
secondary/obsolete/fantasy identifier