Feedback

N-carbamoyl-L-aspartate

PropertiesImageOccurences in reactions
MNX_IDMNXM465Image of MNXM465
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 13
formulaC5H6N2O5
charge-2
mass174.02877
referencechebi:32814
InChIKeyHLKXYZVTANABHZ-REOHCLBHSA-L
InChIInChI=1S/C5H8N2O5/c6-5(12)7-2(4(10)11)1-3(8)9/h2H,1H2,(H,8,9)(H,10,11)(H3,6,7,12)/p-2/t2-/m0/s1
SMILESNC(=O)N[C@@H](CC(=O)[O-])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:32814
chebi:32814
N-carbamoyl-L-aspartate
L-ureidosuccinate
N-carbamoyl-L-aspartate dianion
N-carbamoyl-L-aspartate(2-)
bigg.metabolite:cbasp
biggM:cbasp
sabiork.compound:2049
sabiorkM:2049
kegg.compound:C00438
keggC:C00438
N-Carbamoyl-L-aspartate
seed.compound:cpd00343
seedM:cpd00343
N-Carbamoyl-L-aspartate
N-carbamoyl-L-aspartate
carbamoyl-aspartate
carbamyl-L-aspartate
carbamyl-aspartate
carbamyul-L-aspartate
carbamyul-aspartate
cbasp
metacyc.compound:CARBAMYUL-L-ASPARTATE
metacycM:CARBAMYUL-L-ASPARTATE
N-carbamoyl-L-aspartate
L-ureidosuccinate
carbamoyl-aspartate
carbamyl-L-aspartate
carbamyl-aspartate
carbamyul-L-aspartate
carbamyul-aspartate
reactome:R-ALL-111628
reactomeM:R-ALL-111628
CHEBI:15859
chebi:15859
N-carbamoyl-L-aspartic acid
Carbamyl-L-aspartic acid
L-ureidosuccinic acid
N-(aminocarbonyl)-L-aspartic acid
N-CARBAMOYL-L-ASPARTATE
N-Carbamoyl-L-aspartate
N-carbamoyl-S-aspartic acid
carbamyl-L-aspartic acid
hmdb:HMDB0000828 Ureidosuccinic acid
(2S)-2-(carbamoylamino)butanedioic acid
2-Ureidobutanedioate
2-Ureidobutanedioic acid
Carbamoylaspartic acid
Carbamyl-DL-aspartate
Carbamyl-L-aspartate
Carbamyl-L-aspartic acid
Carbamylaspartic acid
L-N-Carbamoylaspartic acid
L-Ureidosuccinate
L-Ureidosuccinic acid
N-(Aminocarbonyl)-L-aspartate
N-(Aminocarbonyl)-L-aspartic acid
N-Carbamoyl-D-aspartic acid
N-Carbamoyl-L-aspartate
N-Carbamoyl-L-aspartic acid
N-Carbamoyl-S-aspartate
N-Carbamoyl-S-aspartic acid
N-Carbamoylaspartate
N-Carbamoylaspartic acid
NCD
Ureidosuccinate
Ureidosuccinic acid, (D)-isomer
Ureidosuccinic acid, (L)-isomer
Ureidosuccinic acid, cobalt (+2), (1:1) salt,(L)-isomer
Ureidosuccinic acid, maganeese (+2), (1:1) salt
Ureidosuccinic acid, zinc (1:1) salt, (L)-isomer
carbamylaspartic acid
hmdb:HMDB00828
chebi:12496
chebi:12593
chebi:21687
chebi:21688
chebi:44316
chebi:7257
biggM:M_cbasp
keggC:M_C00438
seedM:M_cpd00343
secondary/obsolete/fantasy identifier