Feedback

4-(2-aminophenyl)-2,4-dioxobutanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM466Image of MNXM466
#reac
in my sandbox 0
in MNXref (generic)25
in models (compartimentalized) 5
formulaC10H8NO4
charge-1
mass206.04588
referencechebi:58147
InChIKeyCAOVWYZQMPNAFJ-UHFFFAOYSA-M
InChIInChI=1S/C10H9NO4/c11-7-4-2-1-3-6(7)8(12)5-9(13)10(14)15/h1-4H,5,11H2,(H,14,15)/p-1
SMILESNc1ccccc1C(=O)CC(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58147
chebi:58147
4-(2-aminophenyl)-2,4-dioxobutanoate
4-(2-aminophenyl)-2,4-dioxobutanoate anion
4-(2-aminophenyl)-2,4-dioxobutanoate(1-)
bigg.metabolite:4aphdob
biggM:4aphdob
sabiork.compound:5475
sabiorkM:5475
kegg.compound:C01252
keggC:C01252
4-(2-Aminophenyl)-2,4-dioxobutanoate
seed.compound:cpd00920
seedM:cpd00920
4-(2-Aminophenyl)-2,4-dioxobutanoate
4-(2-aminophenyl)-2,4-dioxobutanoate
hmdb:HMDB0000978 4-(2-Aminophenyl)-2,4-dioxobutanoic acid
2-Amino-alpha,gamma-dioxobenzenebutanoic acid
4-(2-Aminophenyl)-2,4-dioxo-butanoate
4-(2-Aminophenyl)-2,4-dioxo-butanoic acid
4-(2-Aminophenyl)-2,4-dioxobutanoate
4-(2-aminophenyl)-2,4-dioxobutanoic acid
metacyc.compound:CPD-476
metacycM:CPD-476
4-(2-aminophenyl)-2,4-dioxobutanoate
reactome:R-ALL-893615
reactomeM:R-ALL-893615
reactome:R-ALL-893617
reactomeM:R-ALL-893617
CHEBI:17442
chebi:17442
4-(2-aminophenyl)-2,4-dioxobutanoic acid
4-(2-Aminophenyl)-2,4-dioxobutanoate
hmdb:HMDB00978
chebi:11931
chebi:11932
chebi:1765
chebi:20286
biggM:M_4aphdob
keggC:M_C01252
seedM:M_cpd00920
secondary/obsolete/fantasy identifier