Feedback

 

maleylacetate

Image of MNXM472
Properties
MNX_IDMNXM472
formulaC6H4O5
charge-2
mass156.0941
referencechebi:16468
InChIKeySOXXPQLIZIPMIZ-UPHRSURJSA-L
InChIInChI=1S/C6H6O5/c7-4(3-6(10)11)1-2-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/p-2/b2-1-
SMILES[O-]C(=O)CC(=O)\C=C/C([O-])=O

This chemical compound does not exist in my selection



Occurrences of maleylacetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:1184 (2Z)-4-oxohex-2-enedioic acid
(Z)-4-oxo-2-hexenedioic acid
2-Maleylacetate
4-Oxohex-2-enedioate
Maleylacetate
SOXXPQLIZIPMIZ-UPHRSURJSA-N
maleylacetic acid
chebi:11607
chebi:14561
chebi:16468
chebi:19671
(2Z)-4-oxohex-2-enedioate
SOXXPQLIZIPMIZ-UPHRSURJSA-L
maleylacetate
envipath:...d817336c6045 Maleylacetate
hmdb:HMDB60348 (2Z)-4-oxohex-2-enedioic acid
2-Maleylacetate
maleylacetic acid
metacyc:CPD-294 (2Z)-4-oxohex-2-enedioate
2-maleylacetate
4-oxohex-2-enedioate
CPD-294
maleylacetate
kegg:C02222
sabiork:2384
seed:cpd01498
2-Maleylacetate
4-Oxohex-2-enedioate
Maleylacetate
seed:cpd29434 2-maleylacetate
4-oxohex-2-enedioate
maleylacetate
deprecated:MNXM90331