Feedback

(4-hydroxyphenyl)acetaldehyde

PropertiesImageOccurences in reactions
MNX_IDMNXM479Image of MNXM479
#reac
in my sandbox 0
in MNXref (generic)20
in models (compartimentalized) 9
formulaC8H8O2
charge0
mass136.05243
referencechebi:15621
InChIKeyIPRPPFIAVHPVJH-UHFFFAOYSA-N
InChIInChI=1S/C8H8O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,6,10H,5H2
SMILESO=CCc1ccc(O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-500608
reactomeM:R-ALL-500608
CHEBI:15621
chebi:15621
(4-hydroxyphenyl)acetaldehyde
2-(4-Hydroxyphenyl)acetaldehyde
4-Hydroxyphenylacetaldehyde
p-Hydroxyphenylacetaldehyde
pOH-Ph-CH2CHO
metacyc.compound:HYDRPHENYLAC-CPD
metacycM:HYDRPHENYLAC-CPD
(4-hydroxyphenyl)acetaldehyde
HPAL
bigg.metabolite:4hoxpacd
biggM:4hoxpacd
4-Hydroxyphenylacetaldehyde
hmdb:HMDB0003767 4-Hydroxyphenylacetaldehyde
(4-Hydroxyphenyl)acetaldehyde
(p-Hydroxyphenyl)acetaldehyde
2-(4-Hydroxyphenyl)acetaldehyde
2-(4-hydroxyphenyl)acetaldehyde
4-Hydroxybenzeneacetaldehyde
4-Hydroxyphenylacetadehyde
POH-PH-CH2CHO
p-Hydroxyphenylacetaldehyde
p-hydroxyphenylacetaldehyde
seed.compound:cpd02361
seedM:cpd02361
4-Hydroxyphenylacetaldehyde
(4-hydroxyphenyl)acetaldehyde
2-(4-Hydroxyphenyl)acetaldehyde
4hoxpacd
HPAL
sabiork.compound:6840
sabiorkM:6840
kegg.compound:C03765
keggC:C03765
4-Hydroxyphenylacetaldehyde
2-(4-Hydroxyphenyl)acetaldehyde
envipath:...daaaecd2fc96
envipathM:...daaaecd2fc96
compound 42653
envipath:...601157cdee93
envipathM:...601157cdee93
compound 67
hmdb:HMDB03767
chebi:10899
chebi:12012
chebi:1872
chebi:20417
biggM:M_4hoxpacd
keggC:M_C03765
seedM:M_cpd02361
secondary/obsolete/fantasy identifier