Feedback
4-N-(N-Acetyl-D-glucosaminyl)-protein
MNXM483 is deprecated and here replaced by MNXM730896
!!! Alternative mappings exist !!!
| Properties | Image |
| MNX_ID | MNXM730896 |
 |
| reference | keggC:C04375 |
| formula | C13H20N4O8*2 |
| global charge | 0 |
| mol weight | |
| InChIKey | |
| InChI | |
| SMILES | [*]NC(=O)[C@H](CC(=O)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O)NC([*])=O |
MNX internals
| InChI (mnx) | InChI=1/C15H26N4O8/c1-6(21)17-8(14(26)16-3)4-10(23)19-15-11(18-7(2)22)13(25)12(24)9(5-20)27-15/h8-9,11-13,15,20,24-25H,4-5H2,1-3H3,(H,16,26)(H,17,21)(H,18,22)(H,19,23)/t8-,9+,11+,12+,13+,15+/m0/s1/i1+1,3+1 |
 |
| SMILES (mnx) | [13CH3:1][C:6](=[N:17][C@@H:8]([CH2:4][C:10](=[N:19][C@H:15]1[C@H:11]([N:18]=[C:7]([CH3:2])[OH:22])[C@@H:13]([OH:25])[C@H:12]([OH:24])[C@@H:9]([CH2:5][OH:20])[O:27]1)[OH:23])[C:14](=[N:16][13CH3:3])[OH:26])[OH:21] |
|
| Parent-child relations graph |
| Occurences in reactions | #reac |
| in my sandbox |
0 |
| in MNXref (generic) | 5 |
| in models (compartimentalized) |
1 |
|