Feedback

 

D-galactupyranuronate

Image of MNXM48464
Properties
MNX_IDMNXM48464
formulaC6H9O7
charge-1
mass193.132
referencechebi:75525
InChIKeyAEMOLEFTQBMNLQ-YMDCURPLSA-M
InChIInChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/p-1/t1-,2+,3+,4-,6?/m0/s1
SMILESOC1O[C@@H]([C@H](O)[C@H](O)[C@H]1O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-galactupyranuronate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:galur D-Galacturonate
chebi:18024
chebi:20976
chebi:20978
D-galacturonate
D-galacturonic acid
D-galacturonic acids
chebi:4153 AEMOLEFTQBMNLQ-YMDCURPLSA-N
D-Galacturonic acid
D-galactopyranuronic acid
chebi:75525 AEMOLEFTQBMNLQ-YMDCURPLSA-M
D-galactopyranuronate
D-galactupyranuronate
metacyc:D-GALACTURONATE D-GALACTURONATE
D-galactopyranuronic acid
D-galacturonate
D-galacturonic acid
D-galaturonate
galacturonate
galaturonate
metacyc:D-Galactopyranuronate D-Galactopyranuronate
D-galactopyranuronate
D-galactopyranuronic acid
kegg:C00333
sabiork:2020
D-Galacturonate
D-Galacturonic acid
seed:cpd00280 D-Galacturonate
D-Galacturonic acid
galur
deprecated:MNXM11275
deprecated:MNXM149014