Feedback

 

4-hydroxyphenylacetate

Image of MNXM485
Properties
MNX_IDMNXM485
formulaC8H7O3
charge-1
mass151.1399
referencechebi:48999
InChIKeyXQXPVVBIMDBYFF-UHFFFAOYSA-M
InChIInChI=1S/C8H8O3/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1
SMILESOc1ccc(CC([O-])=O)cc1

This chemical compound does not exist in my selection



Occurrences of 4-hydroxyphenylacetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:4hoxpac 4 Hydroxyphenylacetic acid
chebi:12014
chebi:18101
chebi:1874
chebi:20419
chebi:40091
(4-hydroxyphenyl)acetic acid
(p-hydroxyphenyl)acetic acid
4-Hydroxyphenylacetate
4-Hydroxyphenylacetic acid
4-carboxymethylphenol
4-hydroxybenzeneacetic acid
4-hydroxyphenylacetic acid
XQXPVVBIMDBYFF-UHFFFAOYSA-N
p-hydroxyphenylacetic acid
chebi:48999 (4-hydroxyphenyl)acetate
(p-hydroxyphenyl)acetate
2-(4-hydroxyphenyl)ethanoate
4-hydroxybenzeneacetate
4-hydroxyphenylacetate
XQXPVVBIMDBYFF-UHFFFAOYSA-M
envipath:...5cd134f03c97 4-Hydroxyphenylacetate
envipath:...d167cc692982 compound 38564
hmdb:HMDB00020 2-(4-hydroxyphenyl)acetic acid
4-hydroxyphenylacetic acid
p-Hydroxyphenylacetic acid
kegg:C00642 4-Hydroxyphenylacetate
4-Hydroxyphenylacetic acid
metacyc:4-HYDROXYPHENYLACETATE 4-HPA
4-HYDROXYPHENYLACETATE
4-hydroxyphenyl acetate
4-hydroxyphenylacetate
4-hydroxyphenylacetic acid
DL-para-hydroxyphenylacetic acid
benzeneacetic acid, 4-hydroxy-
p-hydroxyphenylacetate
p-hydroxyphenylacetic acid
seed:cpd00489 4-Hydroxyphenyl acetate
4-Hydroxyphenylacetate
4-Hydroxyphenylacetic acid
4hphac