Feedback

 

(S)-ureidoglycolate

Image of MNXM490
Properties
MNX_IDMNXM490
formulaC3H5N2O4
charge-1
mass133.0833
referencechebi:57296
InChIKeyNWZYYCVIOKVTII-SFOWXEAESA-M
InChIInChI=1S/C3H6N2O4/c4-3(9)5-1(6)2(7)8/h1,6H,(H,7,8)(H3,4,5,9)/p-1/t1-/m0/s1
SMILESNC(=O)N[C@@H](O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of (S)-ureidoglycolate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:urdglyc (-)-Ureidoglycolate
chebi:10783
chebi:11076
chebi:121
chebi:15412
chebi:18499
chebi:18804
(-)-Ureidoglycolate
(-)-ureidoglycolic acid
(2S)-(carbamoylamino)(hydroxy)acetic acid
(S)-Ureidoglycolate
(S)-ureidoglycolic acid
NWZYYCVIOKVTII-SFOWXEAESA-N
chebi:57296 (-)-ureidoglycolate
(2S)-(carbamoylamino)(hydroxy)acetate
(S)-ureidoglycolate
NWZYYCVIOKVTII-SFOWXEAESA-M
hmdb:HMDB01005 (2S)-2-(carbamoylamino)-2-hydroxyacetic acid
(S)-Ureidoglycolic acid
ureidoglycolate
kegg:C00603
sabiork:1875
(-)-Ureidoglycolate
(S)-Ureidoglycolate
metacyc:CPD-1091 (-)-ureidoglycolate
CPD-1091
S-(-)-ureidoglycolate
S-ureidoglycolate
ureidoglycolate