Feedback

 

acireductone

Image of MNXM494
Properties
MNX_IDMNXM494
formulaC6H10O3S
charge0
mass162.207
referencechebi:49252
InChIKeyCILXJJLQPTUUSS-XQRVVYSFSA-N
InChIInChI=1S/C6H10O3S/c1-10-3-2-5(8)6(9)4-7/h4,7,9H,2-3H2,1H3/b6-4-
SMILESCSCCC(=O)C(\O)=C\O

This chemical compound does not exist in my selection



Occurrences of acireductone in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dhmtp
kegg:C15606
1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
chebi:49252 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
CILXJJLQPTUUSS-XQRVVYSFSA-N
acireductone
chebi:58795 1-hydroxy-5-(methylsulfanyl)-3-oxopent-1-en-2-olate
1-hydroxy-5-(methylthio)-3-oxopent-1-en-2-olate
CILXJJLQPTUUSS-XQRVVYSFSA-M
hmdb:HMDB12134 (1Z)-1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-Dihydroxy-3-keto-5-methylthiopentene
metacyc:CPD-85 1,2-dihydroxy-3-keto-5-methylthiopentane
1,2-dihydroxy-3-keto-5-methylthiopentene
1,2-dihydroxy-3-keto-5-methylthiopentene anion
1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
CPD-85
acireductone
reactome:1237155 1,2-Dihydroxy-3-oxo-methylthiopentene (1-)
1-hydroxy-5-(methylthio)-3-oxopent-1-en-2-olate
Acireductone
seed:cpd11255 1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
1,2-dihydroxy-3-keto-5-methylthiopentene
12d3k5m
deprecated:MNXM89900