Feedback

1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one

Properties
MNX_IDMNXM494
formulaC6H10O3S
charge0
mass162.2078
referencechebi:49252
Image of MNXM494
InChIKeyCILXJJLQPTUUSS-XQRVVYSFSA-N
InChIInChI=1S/C6H10O3S/c1-10-3-2-5(8)6(9)4-7/h4,7,9H,2-3H2,1H3/b6-4-
SMILESCSCCC(=O)C(\O)=C\O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref13
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd11255 1,2-dihydroxy-3-keto-5-methylthiopentene
1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
1,2-dihydroxy-3-keto-5-methylthiopentane
1,2-dihydroxy-3-keto-5-methylthiopentene anion
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
12d3k5m
acireductone
metacycM:CPD-85 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-dihydroxy-3-keto-5-methylthiopentane
1,2-dihydroxy-3-keto-5-methylthiopentene
1,2-dihydroxy-3-keto-5-methylthiopentene anion
1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
acireductone
biggM:dhmtp 1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
keggC:C15606 1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
1,2-Dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
hmdb:HMDB0012134 1,2-Dihydroxy-3-keto-5-methylthiopentene
(1Z)-1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-Dihydroxy-3-keto-5-methylthiopentane
1,2-Dihydroxy-3-keto-5-methylthiopentene anion
1,2-Dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
Acireductone
biggM:12d3k5m 1 2 dihydroxy 3 keto 5 methylthiopentene
chebi:49252 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
chebi:58795
reactome:R-ALL-1237155
1-hydroxy-5-(methylthio)-3-oxopent-1-en-2-olate
1-hydroxy-5-(methylsulfanyl)-3-oxopent-1-en-2-olate
biggM:M_12d3k5m
biggM:M_M00245
biggM:M_dhmtp
hmdb:HMDB12134
keggC:M_C15606
seedM:M_cpd11255
secondary/obsolete/fantasy identifier
biggM:M00245 1,2-Dihydroxy-5-(Methylthio)Pent-1-En-3-One
MNXM163631is deprecated and replaced by this entry
MNXM89900is deprecated and replaced by this entry