Feedback

1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one

PropertiesImageOccurences in reactions
MNX_IDMNXM494Image of MNXM494
#reac
in my sandbox 0
in MNXref (generic)11
in models (compartimentalized) 6
formulaC6H10O3S
charge0
mass162.2078
referencechebi:49252
InChIKeyCILXJJLQPTUUSS-XQRVVYSFSA-N
InChIInChI=1S/C6H10O3S/c1-10-3-2-5(8)6(9)4-7/h4,7,9H,2-3H2,1H3/b6-4-
SMILESCSCCC(=O)C(\O)=C\O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:49252
chebi:49252
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
bigg.metabolite:12d3k5m
biggM:12d3k5m
1 2 dihydroxy 3 keto 5 methylthiopentene
hmdb:HMDB0012134 1,2-Dihydroxy-3-keto-5-methylthiopentene
(1Z)-1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-Dihydroxy-3-keto-5-methylthiopentane
1,2-Dihydroxy-3-keto-5-methylthiopentene anion
1,2-Dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
Acireductone
bigg.metabolite:M00245
biggM:M00245
1,2-Dihydroxy-5-(Methylthio)Pent-1-En-3-One
bigg.metabolite:dhmtp
biggM:dhmtp
1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
kegg.compound:C15606
keggC:C15606
1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
1,2-Dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
seed.compound:cpd11255
seedM:cpd11255
1,2-dihydroxy-3-keto-5-methylthiopentene
1,2-Dihydroxy-5-(methylthio)pent-1-en-3-one
1,2-dihydroxy-3-keto-5-methylthiopentane
1,2-dihydroxy-3-keto-5-methylthiopentene anion
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
12d3k5m
acireductone
metacyc.compound:CPD-85
metacycM:CPD-85
1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
1,2-dihydroxy-3-keto-5-methylthiopentane
1,2-dihydroxy-3-keto-5-methylthiopentene
1,2-dihydroxy-3-keto-5-methylthiopentene anion
1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
acireductone
reactome:R-ALL-1237155
reactomeM:R-ALL-1237155
CHEBI:58795
chebi:58795
1-hydroxy-5-(methylthio)-3-oxopent-1-en-2-olate
1-hydroxy-5-(methylsulfanyl)-3-oxopent-1-en-2-olate
hmdb:HMDB12134
biggM:M_12d3k5m
biggM:M_M00245
biggM:M_dhmtp
keggC:M_C15606
seedM:M_cpd11255
secondary/obsolete/fantasy identifier