Feedback

 

N-formimidoyl-L-glutamate

Image of MNXM496
Properties
MNX_IDMNXM496
formulaC6H9N2O4
charge-1
mass173.1472
referencechebi:58928
InChIKeyNRXIKWMTVXPVEF-BYPYZUCNSA-M
InChIInChI=1S/C6H10N2O4/c7-3-8-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H2,7,8)(H,9,10)(H,11,12)/p-1/t4-/m0/s1
SMILES[H]C(=[NH2+])N[C@@H](CCC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of N-formimidoyl-L-glutamate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:forglu N-Formimidoyl-L-glutamate
chebi:12502
chebi:18327
chebi:21705
(2S)-2-(methanimidamido)pentanedioate
N-formimidoyl-L-glutamate(2-)
N-methanimidoyl-L-glutamate
NRXIKWMTVXPVEF-BYPYZUCNSA-L
chebi:58928 (2S)-2-[(iminiomethyl)amino]pentanedioate
(2S)-2-[(iminiumylmethyl)amino]pentanedioate
N-(iminiumylmethyl)-L-glutamic acid
N-formimidoyl-L-glutamate
N-formimidoyl-L-glutamate anion
N-formimidoyl-L-glutamate(1-)
NRXIKWMTVXPVEF-BYPYZUCNSA-M
chebi:7274 (2S)-2-(methanimidamido)pentanedioic acid
N-Formimidoyl-L-glutamate
N-Formimino-L-glutamate
N-formimidoyl-L-glutamic acid
N-methanimidoyl-L-glutamic acid
NRXIKWMTVXPVEF-BYPYZUCNSA-N
hmdb:HMDB00854 (2S)-2-methanimidamidopentanedioic acid
Formiminoglutamic acid
N-formimino-L-glutamate
reactome:30158 N-Formimidoyl-L-glutamate
N-Formimino-L-glutamate
N-formimidoyl-L-glutamate(2-)
NF-Glu
deprecated:MNXM512126
deprecated:MNXM91248
deprecated:MNXM96483