Feedback

N-formimidoyl-L-glutamate

PropertiesImageOccurences in reactions
MNX_IDMNXM496Image of MNXM496
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 14
formulaC6H9N2O4
charge-1
mass173.05678
referencechebi:58928
InChIKeyNRXIKWMTVXPVEF-BYPYZUCNSA-M
InChIInChI=1S/C6H10N2O4/c7-3-8-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H2,7,8)(H,9,10)(H,11,12)/p-1/t4-/m0/s1
SMILES[NH2+]=CN[C@@H](CCC(=O)[O-])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58928
chebi:58928
N-formimidoyl-L-glutamate
(2S)-2-[(iminiomethyl)amino]pentanedioate
(2S)-2-[(iminiumylmethyl)amino]pentanedioate
N-(iminiumylmethyl)-L-glutamic acid
N-formimidoyl-L-glutamate anion
N-formimidoyl-L-glutamate(1-)
hmdb:HMDB0000854 Formiminoglutamic acid
(2S)-2-methanimidamidopentanedioic acid
Acid, formiminoglutamic
FIGLU
Formimino-L-glutamate
Formimino-L-glutamic acid
Formimino-glu
Formiminoglutamate
N-(Iminomethyl)-L-glutamic acid
N-Formimidoyl-L-glutamate
N-Formimidoyl-L-glutamic acid
N-Formimidoyl-glutamic acid
N-Formimino-L-glutamate
N-Formimino-L-glutamic acid
N-Formimino-glutamate
N-formimino-L-glutamate
bigg.metabolite:forglu
biggM:forglu
N-Formimidoyl-L-glutamate
sabiork.compound:2050
sabiorkM:2050
kegg.compound:C00439
keggC:C00439
N-Formimino-L-glutamate
N-Formimidoyl-L-glutamate
seed.compound:cpd00344
seedM:cpd00344
N-Formimino-L-glutamate
N-Formimidoyl-L-glutamate
N-formimidoyl-L-glutamate
N-formimino-L-glutamate
N-formimino-glutamate
alpha-formamidinoglutarate
forglu
formimino-glu
formiminoglutamate
reactome:R-ALL-30158
reactomeM:R-ALL-30158
CHEBI:18327
chebi:18327
N-formimidoyl-L-glutamate(2-)
(2S)-2-(methanimidamido)pentanedioate
N-methanimidoyl-L-glutamate
CHEBI:7274
chebi:7274
N-formimidoyl-L-glutamic acid
(2S)-2-(methanimidamido)pentanedioic acid
N-Formimidoyl-L-glutamate
N-Formimino-L-glutamate
N-methanimidoyl-L-glutamic acid
metacyc.compound:N-FORMIMINO-L-GLUTAMATE
metacycM:N-FORMIMINO-L-GLUTAMATE
N-formimino-L-glutamate
N-formimidoyl-L-glutamate
N-formimino-glutamate
alpha-formamidinoglutarate
formimino-glu
formiminoglutamate
hmdb:HMDB00854
chebi:12502
chebi:21705
biggM:M_forglu
keggC:M_C00439
seedM:M_cpd00344
secondary/obsolete/fantasy identifier