Feedback

 

phenylacetate

Image of MNXM497
Properties
MNX_IDMNXM497
formulaC8H7O2
charge-1
mass135.1405
referencechebi:18401
InChIKeyWLJVXDMOQOGPHL-UHFFFAOYSA-M
InChIInChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)/p-1
SMILES[O-]C(=O)Cc1ccccc1

This chemical compound does not exist in my selection



Occurrences of phenylacetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:pac Phenylacetic acid
chebi:14779
chebi:18401
chebi:25975
2-phenylethanoate
WLJVXDMOQOGPHL-UHFFFAOYSA-M
phenylacetate
phenylacetate anion
phenylacetate(1-)
phenylacetic acid anion
chebi:25977
chebi:30745
chebi:44686
chebi:8085
2-PHENYLACETIC ACID
2-Phenylethanoic acid
Benzeneacetic acid
Benzylformic acid
Omega-Phenylacetic acid
PA
Phenylacetic acid
WLJVXDMOQOGPHL-UHFFFAOYSA-N
alpha-toluic acid
benzeneacetic acid
omega-phenylacetic acid
phenylacetic acid
chebi:8082 Acetic acid,phenyl ester
Acetylphenol
IPBVNPXQWQGGJP-UHFFFAOYSA-N
Phenol acetate
Phenyl acetate
phenyl acetate
envipath:...1aa373d9f960 Phenylacetate
hmdb:HMDB00209
hmdb:HMDB01326
2-phenylacetic acid
Phenylacetic acid
omega-phenylacetic acid
hmdb:HMDB40733 Phenyl acetate
phenyl acetate
kegg:C00548 Acetic acid,phenyl ester
Acetylphenol
Phenyl acetate
kegg:C07086 Benzeneacetic acid
Benzylformic acid
Phenylacetate
Phenylacetic acid
kegg:C15583 Phenyl acetate
metacyc:PHENYLACETATE 2-phenylacetate
PHENYLACETATE
benzeneacetic acid
phenylacetate
phenylacetic acid
reactome:177153 phenyl acetate
phenylacetate
sabiork:9203 Acetic acid,phenyl ester
Acetylphenol
Phenyl acetate
Phenylacetate
Phenylacetic acid
seed:cpd19069 Benzeneacetic acid
Benzylformic acid
Phenylacetate
Phenylacetic acid
phenylacetate
deprecated:MNXM90490
deprecated:MNXM92554