Feedback

5-guanidino-3-methyl-2-oxopentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM5014Image of MNXM5014
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC7H13N3O3
charge0
mass187.09569
referencechebi:64263
InChIKeyHLXRGRMMMNFZHD-UHFFFAOYSA-N
InChIInChI=1S/C7H13N3O3/c1-4(5(11)6(12)13)2-3-10-7(8)9/h4H,2-3H2,1H3,(H,12,13)(H4,8,9,10)
SMILESCC(CCNC(N)=[NH2+])C(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:64263
chebi:64263
5-guanidino-3-methyl-2-oxopentanoate
5-carbamimidamido-3-methyl-2-oxopentanoic acid zwitterion
5-guanidino-3-methyl-2-oxopentanoic acid zwitterion
5-{[amino(iminio)methyl]amino}-3-methyl-2-oxopentanoate
kegg.compound:C20234
keggC:C20234
5-Guanidino-3-methyl-2-oxopentanoate
5-Carbamimidamido-3-methyl-2-oxopentanoate
seed.compound:cpd21467
seedM:cpd21467
5-Guanidino-3-methyl-2-oxopentanoate
5-Carbamimidamido-3-methyl-2-oxopentanoate
5-guanidino-3-methyl-2-oxo-pentanoate
5-guanidino-3-methyl-2-oxopentanoate
metacyc.compound:CPD-12430
metacycM:CPD-12430
5-guanidino-3-methyl-2-oxopentanoate
CHEBI:64288
chebi:64288
5-guanidino-3-methyl-2-oxopentanoic acid
5-carbamimidamido-3-methyl-2-oxopentanoic acid
keggC:M_C20234
seedM:M_cpd21467
secondary/obsolete/fantasy identifier