Feedback

5-hydroxypyrrole-2-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM5017Image of MNXM5017
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC5H4NO3
charge-1
mass126.01967
referencechebi:62210
InChIKeyQAJSFWNJRLTBCG-UHFFFAOYSA-M
InChIInChI=1S/C5H5NO3/c7-4-2-1-3(6-4)5(8)9/h1-2,6-7H,(H,8,9)/p-1
SMILESO=C([O-])c1ccc(O)[nH]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:62210
chebi:62210
5-hydroxypyrrole-2-carboxylate
5-hydroxy-1H-pyrrole-2-carboxylate
5-hydroxypyrrole-2-carboxylate anion
5-hydroxypyrrole-2-carboxylate(1-)
envipath:...78e5c5a03781
envipathM:...78e5c5a03781
kegg.compound:C19721
keggC:C19721
5-Hydroxypyrrole-2-carboxylate
seed.compound:cpd20968
seedM:cpd20968
5-Hydroxypyrrole-2-carboxylate
5-hydroxpyrrole-2-carboxylic acid
5-hydroxypyrrole-2-carboxylate
metacyc.compound:CPD-13148
metacycM:CPD-13148
5-hydroxypyrrole-2-carboxylate
5-hydroxpyrrole-2-carboxylic acid
CHEBI:62212
chebi:62212
5-hydroxypyrrole-2-carboxylic acid
5-hydroxy-1H-pyrrole-2-carboxylic acid
keggC:M_C19721
seedM:M_cpd20968
secondary/obsolete/fantasy identifier