Feedback

(E)-4-coumarate

PropertiesImageOccurences in reactions
MNX_IDMNXM505Image of MNXM505
#reac
in my sandbox 0
in MNXref (generic)38
in models (compartimentalized) 21
formulaC9H7O3
charge-1
mass163.04007
referencechebi:12876
InChIKeyNGSWKAQJJWESNS-ZZXKWVIFSA-M
InChIInChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/p-1/b6-3+
SMILESO=C([O-])/C=C/c1ccc(O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:12876
chebi:12876
(E)-4-coumarate
(2E)-3-(4-hydroxyphenyl)acrylate
(2E)-3-(4-hydroxyphenyl)prop-2-enoate
trans-4-coumarate
trans-p-coumarate
hmdb:HMDB0128076 3-(4-hydroxyphenyl)prop-2-enoic acid
3-(4-Hydroxyphenyl)-2-propenoate
3-(4-Hydroxyphenyl)-2-propenoic acid
3-(4-Hydroxyphenyl)acrylate
3-(4-Hydroxyphenyl)acrylic acid
3-(4-Hydroxyphenyl)prop-2-enoate
4'-Hydroxycinnamate
4'-Hydroxycinnamic acid
4-Coumarate
4-Hydroxycinnamate
4-Hydroxycinnamic acid
Para-coumarate
Para-coumaric acid
b-[4-Hydroxyphenyl]acrylate
b-[4-Hydroxyphenyl]acrylic acid
beta-[4-Hydroxyphenyl]acrylate
beta-[4-Hydroxyphenyl]acrylic acid
beta-[4-hydroxyphenyl]acrylate
beta-[4-hydroxyphenyl]acrylic acid
hydroxycinnamic acid
p-Coumarate
p-Coumaric acid
p-Hydroxycinnamate
p-Hydroxycinnamic acid
p-Hydroxyphenylacrylate
p-Hydroxyphenylacrylic acid
seed.compound:cpd00604
seedM:cpd00604
4-Coumarate
4-Hydroxycinnamate
4-Hydroxycinnamic acid
4-coumarate
4-hydroxycinnamate
4-hydroxycinnamic acid
T4hcinnm
p-Coumaric acid
p-coumarate
p-coumaric acid
trans-4-Hydroxycinnamate
trans-4-coumarate
trans-4-hydroxycinnamate
trans-p-Hydroxycinnamate
trans-p-hydroxycinnamate
sabiork.compound:5246
sabiorkM:5246
4-Coumarate
4-Hydroxycinnamate
4-Hydroxycinnamic acid
p-Coumaric acid
trans-4-Hydroxycinnamate
kegg.compound:C00811
keggC:C00811
4-Coumarate
4-Hydroxycinnamate
4-Hydroxycinnamic acid
p-Coumaric acid
trans-4-Hydroxycinnamate
trans-p-Hydroxycinnamate
hmdb:HMDB0002035 4-Hydroxycinnamic acid
(2E)-3-(4-Hydroxyphenyl)-2-propenoic acid
(2E)-3-(4-Hydroxyphenyl)acrylate
(2E)-3-(4-Hydroxyphenyl)acrylic acid
(2E)-3-(4-Hydroxyphenyl)prop-2-enoic acid
(2E)-3-(4-hydroxyphenyl)prop-2-enoic acid
(e)-3-(4-Hydroxyphenyl)-2-propenoate
(e)-3-(4-Hydroxyphenyl)-2-propenoic acid
(e)-3-(4-Hydroxyphenyl)acrylic acid
(e)-4-Hydroxycinnamic acid
(e)-p-Coumarate
(e)-p-Coumaric acid
(e)-p-Hydroxycinnamate
(e)-p-Hydroxycinnamic acid
3-(4-Hydroxyphenyl)-2-propenoate
3-(4-Hydroxyphenyl)-2-propenoic acid
3-(4-Hydroxyphenyl)acrylate
3-(4-Hydroxyphenyl)acrylic acid
4'-HYDROXYCINNAMIC ACID
4'-HYDROXYCINNAMate
4'-hydroxycinnamic acid
4-Coumarate
4-Coumaric acid
4-Coumaric acid, (Z)-isomer
4-Coumaric acid, (e)-isomer
4-Coumaric acid, disodium salt
4-Hydroxy cinnamate
4-Hydroxy cinnamic acid
4-Hydroxycinnamate
4-Hydroxyphenylpropenoate
4-Hydroxyphenylpropenoic acid
Hydroxycinnamate
Hydroxycinnamic acid
Naringeninate
Naringeninic acid
Para coumarate
Para coumaric acid
Para-coumarate
Para-coumaric acid
b-[4-Hydroxyphenyl]acrylate
b-[4-Hydroxyphenyl]acrylic acid
beta-[4-Hydroxyphenyl]acrylate
beta-[4-Hydroxyphenyl]acrylic acid
beta-[4-hydroxyphenyl]acrylic acid
cis-p-Coumarate
coumaric acid
p-Coumarate
p-Coumaric acid
p-Coumaryl alcohol
p-Cumarate
p-Cumaric acid
p-Hydroxy-trans-cinnamic acid
p-Hydroxycinnamate
p-Hydroxycinnamic acid
p-Hydroxyphenylacrylate
p-Hydroxyphenylacrylic acid
p-trans-Coumaric acid
trans-3-(4'-Hydroxyphenyl)-2-propenoic acid
trans-3-(4-Hydroxyphenyl)-2-propenoic acid
trans-4-Coumarate
trans-4-Coumaric acid
trans-4-Hydroxycinnamate
trans-4-Hydroxycinnamic acid
trans-HPPA
trans-p-Coumarate
trans-p-Coumaric acid
trans-p-Coumarinate
trans-p-Coumarinic acid
trans-p-Hydroxycinnamate
trans-p-Hydroxycinnamic acid
metacyc.compound:COUMARATE
metacycM:COUMARATE
4-coumarate
(2E)-3-(4-hydroxyphenyl)acrylate
(2E)-3-(4-hydroxyphenyl)prop-2-enoate
4-hydroxycinnamate
4-hydroxycinnamic acid
p-coumarate
p-coumaric acid
trans-4-coumarate
trans-4-hydroxycinnamate
trans-p-hydroxycinnamate
CHEBI:32373
chebi:32373
4-coumarate
3-(4-hydroxyphenyl)acrylate
3-(4-hydroxyphenyl)prop-2-enoate
4-hydroxycinnamate anion
p-coumarate
CHEBI:36090
chebi:36090
4-coumaric acid
3-(4-hydroxyphenyl)-2-propenoic acid
3-(4-hydroxyphenyl)acrylic acid
3-(4-hydroxyphenyl)prop-2-enoic acid
4'-hydroxycinnamic acid
4-hydroxycinnamic acid
beta-[4-hydroxyphenyl]acrylic acid
p-coumaric acid
p-hydroxycinnamic acid
p-hydroxyphenylacrylic acid
para-coumaric acid
bigg.metabolite:T4hcinnm
biggM:T4hcinnm
Trans 4 Hydroxycinnamate
CHEBI:32374
chebi:32374
trans-4-coumaric acid
(2E)-3-(4-hydroxyphenyl)acrylic acid
(2E)-3-(4-hydroxyphenyl)prop-2-enoic acid
(E)-3-(4-hydroxyphenyl)-2-propenoic acid
(E)-p-coumaric acid
(E)-p-hydroxycinnamic acid
4'-HYDROXYCINNAMIC ACID
4-Hydroxycinnamic acid
naringeninic acid
p-Coumaric acid
trans-4-hydroxycinnamic acid
trans-p-Hydroxycinnamate
trans-p-coumaric acid
trans-p-coumarinic acid
trans-p-hydroxycinnamic acid
hmdb:HMDB02035
chebi:11978
chebi:12007
chebi:1812
chebi:20347
chebi:20348
chebi:20405
chebi:27061
chebi:43108
biggM:M_T4hcinnm
keggC:M_C00811
seedM:M_cpd00604
secondary/obsolete/fantasy identifier