Feedback

 

trans-4-coumarate

Image of MNXM505
Properties
MNX_IDMNXM505
formulaC9H7O3
charge-1
mass163.1506
referencechebi:12876
InChIKeyNGSWKAQJJWESNS-ZZXKWVIFSA-M
InChIInChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/p-1/b6-3+
SMILESOc1ccc(\C=C\C([O-])=O)cc1

This chemical compound does not exist in my selection



Occurrences of trans-4-coumarate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:T4hcinnm Trans 4 Hydroxycinnamate
chebi:11978
chebi:12007
chebi:20347
chebi:32373
3-(4-hydroxyphenyl)acrylate
3-(4-hydroxyphenyl)prop-2-enoate
4-coumarate
4-hydroxycinnamate anion
NGSWKAQJJWESNS-UHFFFAOYSA-M
p-coumarate
chebi:12876 (2E)-3-(4-hydroxyphenyl)acrylate
(2E)-3-(4-hydroxyphenyl)prop-2-enoate
NGSWKAQJJWESNS-ZZXKWVIFSA-M
trans-4-coumarate
trans-p-coumarate
chebi:15796
chebi:1812
chebi:27061
chebi:32374
chebi:43108
(2E)-3-(4-hydroxyphenyl)acrylic acid
(2E)-3-(4-hydroxyphenyl)prop-2-enoic acid
(E)-3-(4-hydroxyphenyl)-2-propenoic acid
(E)-p-coumaric acid
(E)-p-hydroxycinnamic acid
4'-HYDROXYCINNAMIC ACID
4-Hydroxycinnamic acid
NGSWKAQJJWESNS-ZZXKWVIFSA-N
naringeninic acid
p-Coumaric acid
trans-4-coumaric acid
trans-4-hydroxycinnamic acid
trans-p-Hydroxycinnamate
trans-p-coumaric acid
trans-p-coumarinic acid
trans-p-hydroxycinnamic acid
chebi:20348
chebi:20405
chebi:36090
3-(4-hydroxyphenyl)-2-propenoic acid
3-(4-hydroxyphenyl)acrylic acid
3-(4-hydroxyphenyl)prop-2-enoic acid
4'-hydroxycinnamic acid
4-coumaric acid
4-hydroxycinnamic acid
NGSWKAQJJWESNS-UHFFFAOYSA-N
beta-[4-hydroxyphenyl]acrylic acid
p-coumaric acid
p-hydroxycinnamic acid
p-hydroxyphenylacrylic acid
para-coumaric acid
hmdb:HMDB02035 (2E)-3-(4-hydroxyphenyl)prop-2-enoic acid
4-Hydroxycinnamic acid
coumaric acid
kegg:C00811 4-Coumarate
4-Hydroxycinnamate
4-Hydroxycinnamic acid
p-Coumaric acid
trans-4-Hydroxycinnamate
trans-p-Hydroxycinnamate
metacyc:COUMARATE 4-coumarate
4-hydroxycinnamate
4-hydroxycinnamic acid
COUMARATE
p-coumarate
p-coumaric acid
trans-4-coumarate
trans-4-hydroxycinnamate
trans-p-hydroxycinnamate
sabiork:5246 4-Coumarate
4-Hydroxycinnamate
4-Hydroxycinnamic acid
p-Coumaric acid
trans-4-Hydroxycinnamate
seed:cpd00604 4-Coumarate
4-Hydroxycinnamate
4-Hydroxycinnamic acid
T4hcinnm
p-Coumaric acid
trans-4-Hydroxycinnamate
trans-p-Hydroxycinnamate
deprecated:MNXM487095