Feedback

5,10-methenyltetrahydrofolate

PropertiesImageOccurences in reactions
MNX_IDMNXM511Image of MNXM511
#reac
in my sandbox 0
in MNXref (generic)16
in models (compartimentalized) 15
formulaC20H20N7O6
charge-1
mass454.41638
referencechebi:57455
InChIKeyMEANFMOQMXYMCT-OLZOCXBDSA-M
InChIInChI=1S/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33)/p-1/t12-,13+/m1/s1
SMILESNc1nc2NC[C@@H]3CN(C=[N+]3c2c(=O)[nH]1)c1ccc(cc1)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57455
chebi:57455
5,10-methenyltetrahydrofolate
(6R)-5,10-methenyltetrahydrofolate
N-{4-[(6aR)-3-amino-1-oxo-1,2,5,6,6a,7-hexahydro-8H-imidazo[1,5-f]pteridin-10-ium-8-yl]benzoyl}-L-glutamate
hmdb:HMDB0062623 (6R)-5,10-methenyltetrahydrofolate
(6aR)-3-amino-8-(4-{[(1S)-1,3-dicarboxypropyl]carbamoyl}phenyl)-1-oxo-1H,2H,5H,6H,6aH,7H,8H-10lambda5-imidazo[1,5-f]pteridin-10-ylium
(6aR)-3-amino-8-(4-{[(1S)-1,3-dicarboxypropyl]carbamoyl}phenyl)-1-oxo-2H,5H,6H,6aH,7H-10lambda5-imidazo[1,5-f]pteridin-10-ylium
5,10-Methenyltetrahydrofolate
5,10-Methenyltetrahydrofolic acid
5,10-Methenyltetrahydrofolic acid mono-L-glutamic acid
5,10-Methenyltetrahydropteroylglutamate
Anhydroleucovorin
N5,N10-Methenyl tetrahydrofolate
CHEBI:15638
chebi:15638
(6R)-5,10-methenyltetrahydrofolic acid
(6R)-5,10-CH(+)-H4folate
5,10-Methenyltetrahydrofolate
5,10-methenyltetrahydropteroylglutamate
Anhydroleucovorin
N-{4-[(6aR)-3-amino-1-oxo-1,2,5,6,6a,7-hexahydro-8H-imidazo[1,5-f]pteridin-10-ium-8-yl]benzoyl}-L-glutamic acid
bigg.metabolite:methf
biggM:methf
sabiork.compound:1338
sabiorkM:1338
kegg.compound:C00445
keggC:C00445
5,10-Methenyltetrahydrofolate
hmdb:HMDB0001354 5,10-Methenyltetrahydrofolic acid
(6aR)-3-amino-8-(4-{[(1S)-3-carboxy-1-carboxylatopropyl]carbamoyl}phenyl)-1-oxo-1H,4H,5H,6H,6aH,7H,8H-10lambda⁵-imidazo[1,5-f]pteridin-10-ylium
(6aR)-3-amino-8-(4-{[(1S)-3-carboxy-1-carboxylatopropyl]carbamoyl}phenyl)-1-oxo-4H,5H,6H,6aH,7H-10lambda⁵-imidazo[1,5-f]pteridin-10-ylium
5,10-Methenyl-THF
5,10-Methenyltetrahydrofolate
5,10-Methenyltetrahydropteroylglutamate
Anhydroleucovorin
Anhydroleucovorin a
CH-THF
Methenyl-THF
Methenyl-tetrahydrofolate
Methenyltetrahydrofolate
Methenyltetrahydrofolic acid
N5,N10-Methenyl tetrahydrofolate
N5-N10-CH-THF
N5-N10-Methenyltetrahydrofolate
anhydro-Leucovorin
anhydro-Leucovorin a
metacyc.compound:5-10-METHENYL-THF
metacycM:5-10-METHENYL-THF
5,10-methenyltetrahydrofolate mono-L-glutamate
5,10-methenyl-H4PteGlu1
5,10-methenyl-THF mono-L-glutamate
CH-THF mono-L-glutamate
N5-N10-CH-THF mono-L-glutamate
N5-N10-methenyltetrahydrofolate mono-L-glutamate
anhydroleucovorin mono-L-glutamate
methenyl-H4F mono-L-glutamate
methenyl-THF mono-L-glutamate
methenyl-tetrahydrofolate mono-L-glutamate
seed.compound:cpd00347
seedM:cpd00347
5-10-Methenyltetrahydrofolate
5,10-Methenyltetrahydrofolate
5,10-methenyl-H4PteGlu1
5,10-methenyl-THF
5,10-methenyl-THF mono-L-glutamate
5,10-methenyltetrahydrofolate
5,10-methenyltetrahydrofolate mono-L-glutamate
CH-THF
CH-THF mono-L-glutamate
N5-N10-CH-THF mono-L-glutamate
N5-N10-methenyltetrahydrofolate mono-L-glutamate
anhydroleucovorin
anhydroleucovorin mono-L-glutamate
methenyl-H4F
methenyl-H4F mono-L-glutamate
methenyl-THF
methenyl-THF mono-L-glutamate
methenyl-tetrahydrofolate
methenyl-tetrahydrofolate mono-L-glutamate
methf
n5-n10-CH-THF
n5-n10-methenyltetrahydrofolate
hmdb:HMDB01354
hmdb:HMDB62623
chebi:12068
chebi:12069
chebi:1987
biggM:M_methf
keggC:M_C00445
seedM:M_cpd00347
secondary/obsolete/fantasy identifier