Feedback

 

5,10-methenyltetrahydrofolate

Image of MNXM511
Properties
MNX_IDMNXM511
formulaC20H20N7O6
charge-1
mass454.4166
referencechebi:57455
InChIKeyMEANFMOQMXYMCT-OLZOCXBDSA-M
InChIInChI=1S/C20H21N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,9,12-13H,5-8H2,(H6-,21,22,23,24,25,28,29,30,31,32,33)/p-1/t12-,13+/m1/s1
SMILES[H][C@@]12CN(C=[N+]1c1c(NC2)nc(N)[nH]c1=O)c1ccc(cc1)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 5,10-methenyltetrahydrofolate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:12068
chebi:12069
chebi:15638
chebi:1987
(6R)-5,10-CH(+)-H4folate
(6R)-5,10-methenyltetrahydrofolic acid
5,10-Methenyltetrahydrofolate
5,10-methenyltetrahydropteroylglutamate
Anhydroleucovorin
MEANFMOQMXYMCT-OLZOCXBDSA-O
N-{4-[(6aR)-3-amino-1-oxo-1,2,5,6,6a,7-hexahydro-8H-imidazo[1,5-f]pteridin-10-ium-8-yl]benzoyl}-L-glutamic acid
chebi:57455 (6R)-5,10-methenyltetrahydrofolate
5,10-methenyltetrahydrofolate
MEANFMOQMXYMCT-OLZOCXBDSA-M
N-{4-[(6aR)-3-amino-1-oxo-1,2,5,6,6a,7-hexahydro-8H-imidazo[1,5-f]pteridin-10-ium-8-yl]benzoyl}-L-glutamate
hmdb:HMDB01354 (6aR)-3-amino-8-(4-{[(1S)-3-carboxy-1-carboxylatopropyl]carbamoyl}phenyl)-1-oxo-1H,4H,5H,6H,6aH,7H,8H-10lambda⁵-imidazo[1,5-f]pteridin-10-ylium
(6aR)-3-amino-8-(4-{[(1S)-3-carboxy-1-carboxylatopropyl]carbamoyl}phenyl)-1-oxo-4H,5H,6H,6aH,7H-10lambda⁵-imidazo[1,5-f]pteridin-10-ylium
5,10-Methenyltetrahydrofolic acid
hmdb:HMDB62623 (6R)-5,10-methenyltetrahydrofolate
(6aR)-8-(4-{[(1S)-1,3-dicarboxylatopropyl]-C-hydroxycarbonimidoyl}phenyl)-1-hydroxy-3-imino-3H,4H,5H,6H,6aH,7H-8lambda⁵-imidazo[1,5-f]pteridin-8-ylium
(6aR)-8-(4-{[(1S)-1,3-dicarboxylatopropyl]-C-hydroxycarbonimidoyl}phenyl)-1-hydroxy-3-imino-4H,5H,6H,6aH,7H-8lambda⁵-imidazo[1,5-f]pteridin-8-ylium
metacyc:5-10-METHENYL-THF-GLU-N 5-10-METHENYL-THF-GLU-N
a 5,10-methenyl-THF
a 5,10-methenyltetrahydrofolate
reactome:6801458 (6R)-5,10-methenyltetrahydrofolic acid
5,10-methenyl-THF
phys-ent-participant10638
phys-ent-participant32605
phys-ent-participant6530
phys-ent-participant79647
phys-ent-participant79836
phys-ent-participant95986
bigg:methf
kegg:C00445
sabiork:1338
5,10-Methenyltetrahydrofolate
seed:cpd00347 5,10-Methenyltetrahydrofolate
5-10-Methenyltetrahydrofolate
methf
deprecated:MNXM146117
deprecated:MNXM487452