Feedback

 

4-hydroxybutanoate

Image of MNXM514
Properties
MNX_IDMNXM514
formulaC4H7O3
charge-1
mass103.0971
referencechebi:16724
InChIKeySJZRECIVHVDYJC-UHFFFAOYSA-M
InChIInChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/p-1
SMILESOCCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of 4-hydroxybutanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:ghb Gamma-hydroxybutyrate
chebi:12006
chebi:16724
chebi:20401
4-hydroxybutanoate
4-hydroxybutyrate
GHB
SJZRECIVHVDYJC-UHFFFAOYSA-M
gamma-hydroxybutyrate
chebi:1860
chebi:20402
chebi:30830
chebi:386065
3-carboxypropoxy acid
4-Hydroxyalkanoic acid
4-Hydroxybutanoate
4-Hydroxybutanoic acid
4-Hydroxybutyric acid
4-Hydroxycarboxylic acid
4-hydroxy-butyric acid
4-hydroxybutanoic acid
4-hydroxybutyric acid
GHB
Gamma Hydroxybutyric Acid
SJZRECIVHVDYJC-UHFFFAOYSA-N
Xyrem
gamma-Hydroxybutyric acid
gamma-hydroxybutyric acid
oxy-n-butyric acid
envipath:...391ef00bf98c 4-Hydroxybutanoate
hmdb:HMDB00710 4-Hydroxybutyric acid
4-hydroxybutanoic acid
gamma hydroxybutyric acid
hmdb:HMDB15507 4-hydroxybutanoate
Gamma Hydroxybutyric Acid
gamma-hydroxybutyrate
kegg:C00989 4-Hydroxybutanoate
4-Hydroxybutanoic acid
4-Hydroxybutyric acid
lipidmaps:LMFA01050006 4-hydroxy-butanoic acid
4-hydroxy-butyric acid
lipidmaps:LMFA01050006
metacyc:4-HYDROXY-BUTYRATE 4-HYDROXY-BUTYRATE
4-OH-but
4-hydroxybutanoate
4-hydroxybutanoic acid
4-hydroxybutyric acid
g-hydroxybutyric acid
gamma-hydroxybutyrate
gamma-hydroxybutyric acid
reactome:880041 4-hydroxybutyrate
HBUT
sabiork:2203 4-Hydroxybutanoate
4-Hydroxybutanoic acid
4-Hydroxybutyrate
4-Hydroxybutyric acid
gamma-Hydroxybutyrate
seed:cpd00728 4-Hydroxybutanoate
4-Hydroxybutanoic acid
4-Hydroxybutyric acid
4hdxbutn
deprecated:MNXM89865