Feedback

 

orotidine 5'-phosphate(3-)

Image of MNXM519
Properties
MNX_IDMNXM519
formulaC10H10N2O11P
charge-3
mass365.1686
referencechebi:57538
InChIKeyKYOBSHFOBAOFBF-XVFCMESISA-K
InChIInChI=1S/C10H13N2O11P/c13-5-1-3(9(16)17)12(10(18)11-5)8-7(15)6(14)4(23-8)2-22-24(19,20)21/h1,4,6-8,14-15H,2H2,(H,16,17)(H,11,13,18)(H2,19,20,21)/p-3/t4-,6-,7-,8-/m1/s1
SMILESO[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP([O-])([O-])=O)n1c(cc(=O)[nH]c1=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of orotidine 5'-phosphate(3-) in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:orot5p Orotidine 5'-phosphate
chebi:14699
chebi:15842
chebi:25723
chebi:7788
2,6-dioxo-3-(5-O-phosphono-beta-D-ribofuranosyl)-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid
6-carboxy-5'-uridylic acid
KYOBSHFOBAOFBF-XVFCMESISA-N
Orotidine 5'-phosphate
Orotidylic acid
orotidine 5'-(dihydrogen phosphate)
orotidine 5'-phosphate
chebi:57538 2,6-dioxo-3-(5-O-phosphonato-beta-D-ribofuranosyl)-1,2,3,6-tetrahydropyrimidine-4-carboxylate
6-carboxylato-5'-O-phosphonatouridine
KYOBSHFOBAOFBF-XVFCMESISA-K
orotidine 5'-phosphate trianion
orotidine 5'-phosphate(3-)
hmdb:HMDB00218 3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]oxolan-2-yl]-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid
6-carboxy-5'-uridylic acid
Orotidylic acid
metacyc:OROTIDINE-5-PHOSPHATE OROTIDINE-5-PHOSPHATE
orotidine 5'-phosphate
reactome:111629 orotidine 5'-monophosphate
orotidine 5'-phosphate
orotidylic acid
kegg:C01103
sabiork:1700
Orotidine 5'-phosphate
Orotidylic acid
seed:cpd00810 Orotidine 5'-phosphate
Orotidine5-phosphate
Orotidylic acid
orot5p
orotidine 5-phosphate
orotidine-5'-phosphate
deprecated:MNXM89781
deprecated:MNXM92525