Feedback

 

all-trans-retinoate

Image of MNXM521
Properties
MNX_IDMNXM521
formulaC20H27O2
charge-1
mass299.4277
referencechebi:35291
InChIKeySHGAZHPCJJPHSC-YCNIQYBTSA-M
InChIInChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/p-1/b9-6+,12-11+,15-8+,16-14+
SMILESC\C(\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C(/C)=C/C([O-])=O

This chemical compound does not exist in my selection



Occurrences of all-trans-retinoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:retn Retn
chebi:15036 3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoate
SHGAZHPCJJPHSC-UHFFFAOYSA-M
retinoate
chebi:15367
chebi:45376
chebi:8815
(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid
(all-E)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic acid
3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexene-1-yl)-2,4,6,8-nonatetraenoic acid (ECL)
AGN 100335
Acide retinoique (French) (DSL)
RETINOIC ACID
Renova
Retin-A
Retinoic acid
Retisol-A
Ro 1-5488
SHGAZHPCJJPHSC-YCNIQYBTSA-N
Stieva-A
Tretin M
Tretinoine (French) (EINECS)
Vesanoid
Vitamin A acid
all-(E)-Retinoic acid
all-trans-Retinoic acid
all-trans-Tretinoin
all-trans-Vitamin A acid
all-trans-Vitamin A1 acid
all-trans-beta-Retinoic acid
all-trans-retinoic acid
beta-Retinoic acid
trans-Retinoic acid
tretinoin
chebi:26536 3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid
SHGAZHPCJJPHSC-UHFFFAOYSA-N
retinoic acid
chebi:26535
chebi:35291
(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoate
Retinoate
SHGAZHPCJJPHSC-YCNIQYBTSA-M
all-trans-Retinoate
all-trans-retinoate
hmdb:HMDB01852 3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenoic acid
All-trans-retinoic acid
isotretinoin
kegg:C00777
kegg:D00094
(all-E)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic acid
3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexene-1-yl)-2,4,6,8-nonatetraenoic acid (ECL)
AGN 100335
Acide retinoique (French) (DSL)
Avita (TN)
Renova (TN)
Retin A (TN)
Retinoate
Retinoic acid
Ro 1-5488
Tretin M
Tretinoin (JAN/USP/INN)
Tretinoin (TN)
Tretinoine (French) (EINECS)
Vesanoid (TN)
Vitamin A acid
all-(E)-Retinoic acid
all-trans-Retinoate
all-trans-Retinoic acid
all-trans-Tretinoin
all-trans-Vitamin A acid
all-trans-Vitamin A1 acid
all-trans-beta-Retinoic acid
beta-Retinoic acid
trans-Retinoic acid
lipidmaps:LMPR01090019 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2E,4E,6E,8E-tetraenoic acid
Retinoic Acid
Tretinoin/All-Trans Retinoic Acid
lipidmaps:LMPR01090019
metacyc:RETINOATE (all-E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic acid
3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic acid
3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexene-1-yl)-2,4,6,8-nonatetraenoic acid
AGN 100335
RETINOATE
Ro 1-5488
all-(E)-retinoic acid
all-trans vitamin A acid
all-trans vitamin A1 acid
all-trans-beta-retinoic acid
all-trans-retinoate
all-trans-retinoic acid
all-trans-tretinoin
b-retinoic acid
retin A
retinoate
retinoic acid
tretin M
tretinoin
tretinoine
vitamin A acid
reactome:215573
reactome:5334816
all-trans-retinoic acid
atRA
sabiork:5231 (all-E)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8- nonatetraenoic acid
(all-E)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic acid
3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexene-1-yl)-2,4,6,8- nonatetraenoic acid (ECL)
3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexene-1-yl)-2,4,6,8-nonatetraenoic acid (ECL)
AGN 100335
Acide retinoique (French) (DSL)
Retinoate
Retinoic acid
Ro 1-5488
Tretin M
Tretinoine (French) (EINECS)
Vitamin A acid
all-(E)-Retinoic acid
all-trans-Retinoate
all-trans-Retinoic acid
all-trans-Tretinoin
all-trans-Vitamin A acid
all-trans-Vitamin A1 acid
all-trans-beta-Retinoic acid
beta-Retinoic acid
trans-Retinoic acid
seed:cpd00577 (all-E)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8- nonatetraenoic acid
3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexene-1-yl)-2,4,6,8- nonatetraenoic acid (ECL)
AGN 100335
Acide retinoique (French) (DSL)
Retinoate
Retinoic acid
Ro 1-5488
Tretin M
Tretinoine (French) (EINECS)
Vitamin A acid
all-(E)-Retinoic acid
all-trans-Retinoate
all-trans-Retinoic acid
all-trans-Tretinoin
all-trans-Vitamin A acid
all-trans-Vitamin A1 acid
all-trans-beta-Retinoic acid
beta-Retinoic acid
trans-Retinoic acid
deprecated:MNXM89958