|
![]() |
InChIKey | BTJIUGUIPKRLHP-UHFFFAOYSA-M |
InChI | InChI=1S/C6H5NO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H/p-1 |
SMILES | [O-]c1ccc(cc1)[N+]([O-])=O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 99 |
Distinct compatimentalized reactions in models | 9 |
Identifier | Description |
---|---|
seedM:cpd00646 | PNP 4-Hydroxynitrobenzene 4-Nitrophenol 4-hydroxynitrobenzene 4-nitrophenol Niphen niphen p-Nitrophenol p-nitrophenol para-nitrophenol |
chebi:16836 | 4-nitrophenol 4-Hydroxynitrobenzene 4-Nitrophenol Niphen P-NITROPHENOL PNP p-Nitrophenol p-hydroxynitrobenzene paranitrophenol |
envipath:...84bf40475a52 | compound 39868 |
chebi:57917 | 4-nitrophenol 4-nitrobenzen-1-olate 4-nitrophenolate 4-nitrophenolate anion 4-nitrophenolate(1-) p-nitrophenolate p-nitrophenolate anion p-nitrophenolate ion p-nitrophenolate(1-) |
biggM:M_4nph chebi:12034 chebi:1913 chebi:20457 chebi:44390 hmdb:HMDB01232 hmdb:HMDB62627 keggC:M_C00870 seedM:M_cpd00646 | secondary/obsolete/fantasy identifier |
sabiorkM:5292 | p-Nitrophenol 4-Hydroxynitrobenzene 4-Nitrophenol Niphen PNP para-Nitrophenol |
hmdb:HMDB0001232 | 4-Nitrophenol 1-Hydroxy-4-nitrobenzene 4-Hydroxynitrobenzene 4-Nitrophenol, (18)O-labeled CPD 4-Nitrophenol, 1-(13)C-labeled CPD 4-Nitrophenol, 14C-labeled CPD 4-Nitrophenol, 2,6-(13)C2-labeled CPD 4-Nitrophenol, 2,6-(14)C2-labeled CPD 4-Nitrophenol, 2-(14)C-labeled CPD 4-Nitrophenol, aluminum salt 4-Nitrophenol, ammonium salt 4-Nitrophenol, cesium salt 4-Nitrophenol, copper(1+) salt 4-Nitrophenol, ion(1-) 4-Nitrophenol, ion(1-) hydride 4-Nitrophenol, iron(3+) salt 4-Nitrophenol, lithium salt 4-Nitrophenol, manganese (2+) salt 4-Nitrophenol, manganese salt 4-Nitrophenol, potassium salt 4-Nitrophenol, silver(2+) salt 4-Nitrophenol, sodium salt 4-Nitrophenol, sodium salt, (2:1), dihydrate 4-Nitrophenol, tin (2+) salt 4-Nitrophenol, tin (4+) salt 4-Nitrophenol, zinc salt 4-nitrophenol Mononitrophenol Niphen P-Hydroxynitrobenzene P-Nitrophenol P-nitrophenol PNP Paranitrophenol |
metacycM:P-NITROPHENOL | 4-nitrophenol 4-hydroxynitrobenzene PNP niphen p-nitrophenol para-nitrophenol |
envipath:...e768f58b5651 | p-Nitrophenol |
biggM:4nph | 4-Nitrophenol |
hmdb:HMDB0062627 | 4-nitrophenolate 1-Hydroxy-4-nitrobenzene 4-Hydroxynitrobenzene 4-Nitrophenol, (18)O-labeled CPD 4-Nitrophenol, 1-(13)C-labeled CPD 4-Nitrophenol, 14C-labeled CPD 4-Nitrophenol, 2,6-(13)C2-labeled CPD 4-Nitrophenol, 2,6-(14)C2-labeled CPD 4-Nitrophenol, 2-(14)C-labeled CPD 4-Nitrophenol, aluminum salt 4-Nitrophenol, ammonium salt 4-Nitrophenol, cesium salt 4-Nitrophenol, copper(1+) salt 4-Nitrophenol, ion(1-) 4-Nitrophenol, ion(1-) hydride 4-Nitrophenol, iron(3+) salt 4-Nitrophenol, lithium salt 4-Nitrophenol, manganese (2+) salt 4-Nitrophenol, manganese salt 4-Nitrophenol, potassium salt 4-Nitrophenol, silver(2+) salt 4-Nitrophenol, sodium salt 4-Nitrophenol, sodium salt, (2:1), dihydrate 4-Nitrophenol, tin (2+) salt 4-Nitrophenol, tin (4+) salt 4-Nitrophenol, zinc salt 4-nitrophenol Mononitrophenol Niphen P-Hydroxynitrobenzene P-Nitrophenol P-nitrophenol PNP Paranitrophenol |
keggC:C00870 | 4-Nitrophenol 4-Hydroxynitrobenzene Niphen PNP p-Nitrophenol |
MNXM162908 | is deprecated and replaced by this entry |
MNXM724114 | is deprecated and replaced by this entry |