| Properties | Image |
| MNX_ID | MNXM527204 |
 |
| reference | envipathM:...11b16e9170d4 |
| formula | C11H17N3O2 |
| global charge | 0 |
| mol weight | 223.276 |
| InChIKey | DVLMVKDOFMLUEE-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H17N3O2/c1-10(2,3)11(5-4-9(15)16-11)6-14-8-12-7-13-14/h7-8H,4-6H2,1-3H3 |
| SMILES | CC(C)(C)C1(CN2C=NC=N2)CCC(=O)O1 |
MNX internals
| InChI (mnx) | InChI=1/C11H17N3O2/c1-10(2,3)11(5-4-9(15)16-11)6-14-8-12-7-13-14/h7-8H,4-6H2,1-3H3/t11? |
 |
| SMILES (mnx) | [CH3:1][C:10]([CH3:2])([CH3:3])[C:11]1([CH2:6][N:14]2[CH:8]=[N:12][CH:7]=[N:13]2)[CH2:5][CH2:4][C:9](=[O:15])[O:16]1 |
|