Feedback

 

meso-2,6-diaminopimelate

Image of MNXM529
Properties
MNX_IDMNXM529
formulaC7H14N2O4
charge0
mass190.1971
referencechebi:57791
InChIKeyGMKMEZVLHJARHF-SYDPRGILSA-N
InChIInChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5+
SMILES[NH3+][C@@H](CCC[C@@H]([NH3+])C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of meso-2,6-diaminopimelate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:26dap__M Meso-2,6-Diaminoheptanedioate
chebi:10598
chebi:16488
chebi:25204
chebi:40838
(2R*,6S*)-2,6-diaminoheptanedioic acid
GMKMEZVLHJARHF-SYDPRGILSA-N
meso-2,6-Diaminopimelic acid
meso-2,6-diaminopimelic acid
meso-diaminoheptanedioic acid
chebi:12822
chebi:12823
chebi:12825
chebi:25203
chebi:30308
(2R,6S)-2,6-diaminoheptanedioate
GMKMEZVLHJARHF-SYDPRGILSA-L
meso-2,6-Diaminoheptanedioate
meso-2,6-Diaminopimelate
meso-2,6-diaminopimelate
meso-2,6-diaminopimelate(2-)
meso-Diaminoheptanedioate
chebi:57791 (2R,6S)-2,6-diammonioheptanedioate
(2R,6S)-2,6-diazaniumylheptanedioate
GMKMEZVLHJARHF-SYDPRGILSA-N
meso-2,6-diaminopimelate
meso-2,6-diaminopimelic acid dizwitterion
meso-2,6-diaminopimelic acid zwitterion
kegg:C00680 meso-2,6-Diaminoheptanedioate
meso-2,6-Diaminopimelate
meso-2,6-Diaminopimelic acid
meso-Diaminoheptanedioate
metacyc:MESO-DIAMINOPIMELATE D,L-DAP
D,L-diaminopimelate
D,L-meso-diaminoheptanedioate
M-DAP
MESO-DIAMINOPIMELATE
meso-1-alpha,epsilon-diaminopimelate
meso-2,6-diaminoheptanedioate
meso-2,6-diaminopimelate
meso-A2pm
meso-diaminoheptanedioate
meso-diaminopimelate
seed:cpd00516 26dap-M
meso-2,6-Diaminoheptanedioate
meso-2,6-Diaminopimelate
meso-2,6-Diaminopimelic acid
meso-2-6-Diaminoheptanedioate
meso-Diaminoheptanedioate