Feedback

(R)-3-sulfolactate

PropertiesImageOccurences in reactions
MNX_IDMNXM530Image of MNXM530
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC3H4O6S
charge-2
mass168.12626
referencechebi:58738
InChIKeyCQQGIWJSICOUON-REOHCLBHSA-L
InChIInChI=1S/C3H6O6S/c4-2(3(5)6)1-10(7,8)9/h2,4H,1H2,(H,5,6)(H,7,8,9)/p-2/t2-/m0/s1
SMILESO[C@@H](CS([O-])(=O)=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58738
chebi:58738
(R)-3-sulfolactate
(2R)-2-hydroxy-3-sulfonatopropanoate
(2R)-3-sulfolactate
seed.compound:cpd08367
seedM:cpd08367
(2R)-3-Sulfolactate
(2R)-2-hydroxy-3-sulfopropanoate
(2R)-3-sulfolactate
(R)-3-Sulfolactate
(R)-3-sulfolactic acid
(R)-sulfolactate
D-sulfolactate
L-sulfolactate
kegg.compound:C11537
keggC:C11537
(2R)-3-Sulfolactate
(R)-3-Sulfolactate
metacyc.compound:CPD-367
metacycM:CPD-367
(2R)-3-sulfolactate
(2R)-2-hydroxy-3-sulfopropanoate
(R)-3-sulfolactic acid
(R)-sulfolactate
D-sulfolactate
CHEBI:48291
chebi:48291
(R)-3-sulfolactic acid
(2R)-2-hydroxy-3-sulfopropanoate
(2R)-2-hydroxy-3-sulfopropanoic acid
(2R)-3-SULFOLACTIC ACID
(2R)-3-Sulfolactate
chebi:11890
chebi:16071
chebi:1667
chebi:38022
chebi:39945
keggC:M_C11537
seedM:M_cpd08367
secondary/obsolete/fantasy identifier