Feedback

3-phosphooxypyruvate

PropertiesImageOccurences in reactions
MNX_IDMNXM541Image of MNXM541
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 5
formulaC3H2O7P
charge-3
mass181.017541
referencechebi:18110
InChIKeyLFLUCDOSQPJJBE-UHFFFAOYSA-K
InChIInChI=1S/C3H5O7P/c4-2(3(5)6)1-10-11(7,8)9/h1H2,(H,5,6)(H2,7,8,9)/p-3
SMILES[O-]C(=O)C(=O)COP([O-])([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18110
chebi:18110
3-phosphooxypyruvate
2-oxo-3-(phosphonatooxy)propanoate
3-Phosphohydroxypyruvate
3-Phosphonooxypyruvate
3-phosphonatooxypyruvate(3-)
phosphohydroxypyruvate
bigg.metabolite:3php
biggM:3php
3-Phosphohydroxypyruvate
sabiork.compound:2712
sabiorkM:2712
3-Phosphohydroxypyruvate
3-Phosphohydroxypyruvic acid
3-Phosphonooxypyruvate
3-Phosphonooxypyruvic acid
seed.compound:cpd02069
seedM:cpd02069
3-Phosphonooxypyruvate
3-P-hydroxypyruvate
3-Phosphohydroxypyruvate
3-Phosphohydroxypyruvic acid
3-Phosphonooxypyruvic acid
3-p-OH-pyr
3-p-OH-pyruvate
3-p-hydroxy-pyr
3-phospho-hydroxypyruvate
3-phosphohydroxy-pyr
3-phosphohydroxypyruvate
3-phosphonooxypyruvate
3-phosphooxypyruvate
3php
phosphohydroxypyruate
phosphohydroxypyruvate
kegg.compound:C03232
keggC:C03232
3-Phosphonooxypyruvate
3-Phosphohydroxypyruvate
3-Phosphohydroxypyruvic acid
3-Phosphonooxypyruvic acid
3-Phosphooxypyruvate
reactome:R-ALL-977329
reactomeM:R-ALL-977329
CHEBI:30933
chebi:30933
3-phosphonooxypyruvic acid
2-oxo-3-(phosphonooxy)propanoic acid
3-Phosphohydroxypyruvic acid
3-Phosphonooxypyruvic acid
Hydroxypyruvic acid phosphate
phosphohydroxypyruvic acid
metacyc.compound:3-P-HYDROXYPYRUVATE
metacycM:3-P-HYDROXYPYRUVATE
3-phosphooxypyruvate
3-P-hydroxypyruvate
3-p-OH-pyr
3-p-OH-pyruvate
3-p-hydroxy-pyr
3-phospho-hydroxypyruvate
3-phosphohydroxy-pyr
3-phosphohydroxypyruvate
3-phosphonooxypyruvate
phosphohydroxypyruate
phosphohydroxypyruvate
hmdb:HMDB0001024 Phosphohydroxypyruvic acid
2-oxo-3-(Phosphonooxy)-propanoate
2-oxo-3-(Phosphonooxy)-propanoic acid
2-oxo-3-(phosphonooxy)propanoic acid
3-Phosphohydroxypyruvate
3-Phosphohydroxypyruvic acid
3-Phosphonatooxypyruvate
3-Phosphonooxypyruvate
3-Phosphonooxypyruvic acid
Hydroxypyruvate phosphate
Hydroxypyruvic acid phosphate
Hydroxypyruvic acid phosphoric acid
Phosphohydroxypyruvate
phosphohydroxypyruvate
hmdb:HMDB0060175
hmdb:HMDB01024
hmdb:HMDB60175
chebi:11883
chebi:11884
chebi:1661
chebi:20191
chebi:20192
biggM:M_3php
keggC:M_C03232
seedM:M_cpd02069
secondary/obsolete/fantasy identifier