Feedback

 

preuroporphyrinogen(8-)

Image of MNXM547
Properties
MNX_IDMNXM547
formulaC40H38N4O17
charge-8
mass846.7507
referencechebi:57845
InChIKeyWDFJYRZCZIUBPR-UHFFFAOYSA-F
InChIInChI=1S/C40H46N4O17/c45-17-32-25(12-40(60)61)21(4-8-36(52)53)29(44-32)15-31-24(11-39(58)59)20(3-7-35(50)51)28(43-31)14-30-23(10-38(56)57)19(2-6-34(48)49)27(42-30)13-26-22(9-37(54)55)18(16-41-26)1-5-33(46)47/h16,41-45H,1-15,17H2,(H,46,47)(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H,56,57)(H,58,59)(H,60,61)/p-8
SMILESOCc1[nH]c(Cc2[nH]c(Cc3[nH]c(Cc4[nH]cc(CCC([O-])=O)c4CC([O-])=O)c(CCC([O-])=O)c3CC([O-])=O)c(CCC([O-])=O)c2CC([O-])=O)c(CCC([O-])=O)c1CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of preuroporphyrinogen(8-) in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:hmbil
kegg:C01024
sabiork:5362
Hydroxymethylbilane
chebi:14423
chebi:16645
chebi:24716
chebi:5809
(hydroxymethyl)bilane
3,8,13,18-tetrakis(carboxymethyl)-19-(hydroxymethyl)bilane-2,7,12,17-tetrapropanoic acid
3,8,13,18-tetrakis(carboxymethyl)-5,10,15,22,23,24-hexahydro-19-(hydroxymethyl)-21H-biline-2,7,12,17-tetrapropanoic acid
Hydroxymethylbilane
WDFJYRZCZIUBPR-UHFFFAOYSA-N
preuroporphyrinogen
chebi:57845 3,8,13,18-tetrakis(carboxylatomethyl)-19-(hydroxymethyl)bilane-2,7,12,17-tetrapropanoate
WDFJYRZCZIUBPR-UHFFFAOYSA-F
preuroporphyrinogen octaanion
preuroporphyrinogen(8-)
hmdb:HMDB01137 3-(2-{[4-(2-carboxyethyl)-5-{[4-(2-carboxyethyl)-5-{[4-(2-carboxyethyl)-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl}-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl}-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl}-4-(carboxymethyl)-5-(hydroxymethyl)-1H-pyrrol-3-yl)propanoic acid
Hydroxymethylbilane
hydroxymethylbilane
metacyc:HYDROXYMETHYLBILANE HYDROXYMETHYLBILANE
hydroxymethylbilane
preuroporphyrinogen
reactome:189449 HMBL
Hydroxymethylbilane
preuroporphyrinogen
seed:cpd00755 Hydroxymethylbilane
hmbil
deprecated:MNXM89829
deprecated:MNXM90725