Feedback

hydroxymethylbilane

PropertiesImageOccurences in reactions
MNX_IDMNXM547Image of MNXM547
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 8
formulaC40H38N4O17
charge-8
mass846.74648
referencechebi:57845
InChIKeyWDFJYRZCZIUBPR-UHFFFAOYSA-F
InChIInChI=1S/C40H46N4O17/c45-17-32-25(12-40(60)61)21(4-8-36(52)53)29(44-32)15-31-24(11-39(58)59)20(3-7-35(50)51)28(43-31)14-30-23(10-38(56)57)19(2-6-34(48)49)27(42-30)13-26-22(9-37(54)55)18(16-41-26)1-5-33(46)47/h16,41-45H,1-15,17H2,(H,46,47)(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H,56,57)(H,58,59)(H,60,61)/p-8
SMILESOCc1[nH]c(Cc2[nH]c(Cc3[nH]c(Cc4[nH]cc(CCC([O-])=O)c4CC([O-])=O)c(CCC([O-])=O)c3CC([O-])=O)c(CCC([O-])=O)c2CC([O-])=O)c(CCC([O-])=O)c1CC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-189449
reactomeM:R-ALL-189449
CHEBI:57845
chebi:57845
hydroxymethylbilane
3,8,13,18-tetrakis(carboxylatomethyl)-19-(hydroxymethyl)bilane-2,7,12,17-tetrapropanoate
preuroporphyrinogen octaanion
preuroporphyrinogen(8-)
bigg.metabolite:hmbil
biggM:hmbil
sabiork.compound:5362
sabiorkM:5362
kegg.compound:C01024
keggC:C01024
Hydroxymethylbilane
hmdb:HMDB0001137 Hydroxymethylbilane
(Hydroxymethyl)bilane
3,8,13,18-Tetrakis(carboxymethyl)-19-(hydroxymethyl)bilane-2,7,12,17-tetrapropanoate
3,8,13,18-Tetrakis(carboxymethyl)-19-(hydroxymethyl)bilane-2,7,12,17-tetrapropanoic acid
3,8,13,18-Tetrakis(carboxymethyl)-5,10,15,22,23,24-hexahydro-19-(hydroxymethyl)-21H-biline-2,7,12,17-tetrapropanoate
3,8,13,18-Tetrakis(carboxymethyl)-5,10,15,22,23,24-hexahydro-19-(hydroxymethyl)-21H-biline-2,7,12,17-tetrapropanoic acid
3-(2-{[4-(2-carboxyethyl)-5-{[4-(2-carboxyethyl)-5-{[4-(2-carboxyethyl)-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl}-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl}-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl}-4-(carboxymethyl)-5-(hydroxymethyl)-1H-pyrrol-3-yl)propanoic acid
3-[2-[[4-(2-Carboxyethyl)-5-[[4-(2-carboxyethyl)-5-[[4-(2-carboxyethyl)-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl]-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl]-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl]-4-(carboxymethyl)-5-(hydroxymethyl)-1H-pyrrol-3-yl]propanoate
3-[2-[[4-(2-Carboxyethyl)-5-[[4-(2-carboxyethyl)-5-[[4-(2-carboxyethyl)-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl]-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl]-3-(carboxymethyl)-1H-pyrrol-2-yl]methyl]-4-(carboxymethyl)-5-(hydroxymethyl)-1H-pyrrol-3-yl]propanoic acid
Preuroporphyrinogen
hydroxymethylbilane
seed.compound:cpd00755
seedM:cpd00755
Hydroxymethylbilane
hmbil
hydroxymethylbilane
preuroporphyrinogen
CHEBI:16645
chebi:16645
preuroporphyrinogen
(hydroxymethyl)bilane
3,8,13,18-tetrakis(carboxymethyl)-19-(hydroxymethyl)bilane-2,7,12,17-tetrapropanoic acid
3,8,13,18-tetrakis(carboxymethyl)-5,10,15,22,23,24-hexahydro-19-(hydroxymethyl)-21H-biline-2,7,12,17-tetrapropanoic acid
Hydroxymethylbilane
metacyc.compound:HYDROXYMETHYLBILANE
metacycM:HYDROXYMETHYLBILANE
preuroporphyrinogen
hydroxymethylbilane
hmdb:HMDB01137
chebi:14423
chebi:24716
chebi:5809
biggM:M_hmbil
keggC:M_C01024
seedM:M_cpd00755
secondary/obsolete/fantasy identifier