Feedback

1,4-dihydroxy-2-naphthoate

PropertiesImageOccurences in reactions
MNX_IDMNXM552Image of MNXM552
#reac
in my sandbox 0
in MNXref (generic)44
in models (compartimentalized) 15
formulaC11H7O4
charge-1
mass203.03498
referencechebi:11173
InChIKeyVOJUXHHACRXLTD-UHFFFAOYSA-M
InChIInChI=1S/C11H8O4/c12-9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5,12-13H,(H,14,15)/p-1
SMILESO=C([O-])c1cc(O)c2ccccc2c1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:11173
chebi:11173
1,4-dihydroxy-2-naphthoate
1,4-dihydroxynaphthalene-2-carboxylate
bigg.metabolite:dhna
biggM:dhna
1,4-Dihydroxy-2-naphthoate
kegg.compound:C03657
keggC:C03657
1,4-Dihydroxy-2-naphthoate
1,4-Dihydroxy-2-naphthoic acid
metacyc.compound:DIHYDROXYNAPHTHOATE
metacycM:DIHYDROXYNAPHTHOATE
1,4-dihydroxy-2-naphthoate
2-carboxy-1,4-naphthoquinol
DHNA
CHEBI:18094
chebi:18094
1,4-dihydroxy-2-naphthoic acid
1,4-Dihydroxy-2-naphthalenecarboxylic acid
1,4-Dihydroxy-2-naphthoic acid
1,4-dihydroxynaphthalene-2-carboxylic acid
seed.compound:cpd02295
seedM:cpd02295
1-4-Dihydroxy-2-naphthoate
1,4-Dihydroxy-2-naphthoate
1,4-Dihydroxy-2-naphthoic acid
1,4-dihydroxy-2-naphthoate
2-carboxy-1,4-naphthoquinol
DHNA
dhna
chebi:18933
chebi:539
biggM:M_dhna
keggC:M_C03657
seedM:M_cpd02295
secondary/obsolete/fantasy identifier