Feedback

1,4-dihydroxy-2-naphthoate

Properties
MNX_IDMNXM552
formulaC11H7O4
charge-1
mass203.17088
referencechebi:11173
Image of MNXM552
InChIKeyVOJUXHHACRXLTD-UHFFFAOYSA-M
InChIInChI=1S/C11H8O4/c12-9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5,12-13H,(H,14,15)/p-1
SMILESOc1cc(C([O-])=O)c(O)c2ccccc12

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref45
Distinct compatimentalized reactions in models15

Similar chemical compounds in external resources
IdentifierDescription
biggM:M_dhna
chebi:18933
chebi:539
keggC:M_C03657
seedM:M_cpd02295
secondary/obsolete/fantasy identifier
chebi:11173 1,4-dihydroxy-2-naphthoate
1,4-dihydroxynaphthalene-2-carboxylate
keggC:C03657 1,4-Dihydroxy-2-naphthoate
1,4-Dihydroxy-2-naphthoic acid
metacycM:DIHYDROXYNAPHTHOATE 1,4-dihydroxy-2-naphthoate
2-carboxy-1,4-naphthoquinol
DHNA
chebi:18094 1,4-dihydroxy-2-naphthoic acid
1,4-Dihydroxy-2-naphthalenecarboxylic acid
1,4-Dihydroxy-2-naphthoic acid
1,4-dihydroxynaphthalene-2-carboxylic acid
biggM:dhna 1,4-Dihydroxy-2-naphthoate
seedM:cpd02295 1-4-Dihydroxy-2-naphthoate
1,4-Dihydroxy-2-naphthoate
1,4-Dihydroxy-2-naphthoic acid
1,4-dihydroxy-2-naphthoate
2-carboxy-1,4-naphthoquinol
DHNA
dhna