Feedback

 

1,4-dihydroxy-2-naphthoate

Image of MNXM552
Properties
MNX_IDMNXM552
formulaC11H7O4
charge-1
mass203.1714
referencechebi:11173
InChIKeyVOJUXHHACRXLTD-UHFFFAOYSA-M
InChIInChI=1S/C11H8O4/c12-9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5,12-13H,(H,14,15)/p-1
SMILESOc1cc(C([O-])=O)c(O)c2ccccc12

This chemical compound does not exist in my selection



Occurrences of 1,4-dihydroxy-2-naphthoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dhna 1,4-Dihydroxy-2-naphthoate
chebi:11173 1,4-dihydroxy-2-naphthoate
1,4-dihydroxynaphthalene-2-carboxylate
VOJUXHHACRXLTD-UHFFFAOYSA-M
chebi:18094
chebi:18933
chebi:539
1,4-Dihydroxy-2-naphthalenecarboxylic acid
1,4-Dihydroxy-2-naphthoic acid
1,4-dihydroxy-2-naphthoic acid
1,4-dihydroxynaphthalene-2-carboxylic acid
VOJUXHHACRXLTD-UHFFFAOYSA-N
kegg:C03657 1,4-Dihydroxy-2-naphthoate
1,4-Dihydroxy-2-naphthoic acid
metacyc:DIHYDROXYNAPHTHOATE 1,4-dihydroxy-2-naphthoate
2-carboxy-1,4-naphthoquinol
DHNA
DIHYDROXYNAPHTHOATE
seed:cpd02295 1,4-Dihydroxy-2-naphthoate
1-4-Dihydroxy-2-naphthoate
dhna