Feedback

 

quinolinate

Image of MNXM555
Properties
MNX_IDMNXM555
formulaC7H3NO4
charge-2
mass165.1041
referencechebi:29959
InChIKeyGJAWHXHKYYXBSV-UHFFFAOYSA-L
InChIInChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)/p-2
SMILES[O-]C(=O)c1cccnc1C([O-])=O

This chemical compound does not exist in my selection



Occurrences of quinolinate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:quln Quinolinate
chebi:132942 quinolinate
quinolinate anion
quinolinic acid anion
chebi:14975
chebi:26417
chebi:29959
GJAWHXHKYYXBSV-UHFFFAOYSA-L
pyridine-2,3-dicarboxylate
quinolinate
quinolinate(2-)
chebi:16675
chebi:26418
chebi:44529
chebi:8663
2,3-Pyridinedicarboxylic acid
GJAWHXHKYYXBSV-UHFFFAOYSA-N
Pyridine-2,3-dicarboxylate
QUINOLINIC ACID
Quinolinic acid
pyridine-2,3-dicarboxylic acid
quinolinic acid
chebi:46828 GJAWHXHKYYXBSV-UHFFFAOYSA-M
hydrogen pyridine-2,3-dicarboxylate
quinolinate(1-)
chebi:46832 3-carboxypyridine-2-carboxylate
GJAWHXHKYYXBSV-UHFFFAOYSA-M
chebi:46833 2-carboxynicotinate
2-carboxypyridine-3-carboxylate
GJAWHXHKYYXBSV-UHFFFAOYSA-M
hmdb:HMDB00232 Quinolinic acid
pyridine-2,3-dicarboxylic acid
quinolinic acid
metacyc:QUINOLINATE 2,3-pyridinedicarboxylate
2,3-pyridinedicarboxylic acid
QUINOLINATE
pyridine-2,3-dicarboxylate
pyridine-2,3-dicarboxylic acid
quinolinate
quinolinic acid
reactome:197238 QUIN
Quinolinate
quinolinate(1-)
kegg:C03722
sabiork:6817
2,3-Pyridinedicarboxylic acid
Pyridine-2,3-dicarboxylate
Quinolinate
Quinolinic acid
seed:cpd02333 2,3-Pyridinedicarboxylic acid
Pyridine-2,3-dicarboxylate
Quinolinate
Quinolinic acid
quln
deprecated:MNXM90304