Feedback

quinolinate

Properties
MNX_IDMNXM555
formulaC7H3NO4
charge-2
mass165.10306
referencechebi:29959
Image of MNXM555
InChIKeyGJAWHXHKYYXBSV-UHFFFAOYSA-L
InChIInChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)/p-2
SMILES[O-]C(=O)c1cccnc1C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref14
Distinct compatimentalized reactions in models10

Similar chemical compounds in external resources
IdentifierDescription
biggM:quln Quinolinate
chebi:46828 quinolinate(1-)
hydrogen pyridine-2,3-dicarboxylate
chebi:46832 3-carboxypyridine-2-carboxylate
hmdb:HMDB0000232 Quinolinic acid
2,3-Pyridinedicarboxylate
2,3-Pyridinedicarboxylic acid
3,4-Pyridinedicarboxylic acid
Pyridin-2,3-dicarbonsaeure
Pyridine-2,3-carboxylate
Pyridine-2,3-dicarboxylate
Pyridine-2,3-dicarboxylic acid
Pyridine-3,4-dicarboxylic acid
Quinolinate
Quinolinic acid, copper(2+) salt
Quinolinic acid, disodium salt
Quinolinic acid, strontium salt
pyridine-2,3-dicarboxylic acid
quinolinic acid
chebi:132942 quinolinate
quinolinate anion
quinolinic acid anion
metacycM:QUINOLINATE quinolinate
2,3-pyridinedicarboxylate
2,3-pyridinedicarboxylic acid
pyridine-2,3-dicarboxylate
pyridine-2,3-dicarboxylic acid
quinolinic acid
sabiorkM:6817 Pyridine-2,3-dicarboxylate
2,3-Pyridinedicarboxylic acid
Quinolinate
Quinolinic acid
chebi:16675 quinolinic acid
2,3-Pyridinedicarboxylic acid
Pyridine-2,3-dicarboxylate
QUINOLINIC ACID
Quinolinic acid
pyridine-2,3-dicarboxylic acid
seedM:cpd02333 Quinolinate
2,3-Pyridinedicarboxylic acid
2,3-pyridinedicarboxylate
2,3-pyridinedicarboxylic acid
Pyridine-2,3-dicarboxylate
Quinolinic acid
pyridine-2,3-dicarboxylate
pyridine-2,3-dicarboxylic acid
quinolinate
quinolinic acid
quln
chebi:29959
reactome:R-ALL-197238
quinolinate
pyridine-2,3-dicarboxylate
quinolinate(2-)
biggM:M_quln
chebi:14975
chebi:26417
chebi:26418
chebi:44529
chebi:8663
hmdb:HMDB00232
keggC:M_C03722
seedM:M_cpd02333
secondary/obsolete/fantasy identifier
chebi:46833 2-carboxypyridine-3-carboxylate
2-carboxynicotinate
keggC:C03722 Quinolinate
2,3-Pyridinedicarboxylic acid
Pyridine-2,3-dicarboxylate
Quinolinic acid
MNXM90304is deprecated and replaced by this entry