Feedback

quinolinate

PropertiesImageOccurences in reactions
MNX_IDMNXM555Image of MNXM555
#reac
in my sandbox 0
in MNXref (generic)15
in models (compartimentalized) 12
formulaC7H3NO4
charge-2
mass165.10306
referencechebi:29959
InChIKeyGJAWHXHKYYXBSV-UHFFFAOYSA-L
InChIInChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)/p-2
SMILES[O-]C(=O)c1cccnc1C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-197238
reactomeM:R-ALL-197238
CHEBI:29959
chebi:29959
quinolinate
pyridine-2,3-dicarboxylate
quinolinate(2-)
CHEBI:46833
chebi:46833
2-carboxypyridine-3-carboxylate
2-carboxynicotinate
CHEBI:46832
chebi:46832
3-carboxypyridine-2-carboxylate
sabiork.compound:6817
sabiorkM:6817
Pyridine-2,3-dicarboxylate
2,3-Pyridinedicarboxylic acid
Quinolinate
Quinolinic acid
bigg.metabolite:quln
biggM:quln
Quinolinate
seed.compound:cpd02333
seedM:cpd02333
Quinolinate
2,3-Pyridinedicarboxylic acid
2,3-pyridinedicarboxylate
2,3-pyridinedicarboxylic acid
Pyridine-2,3-dicarboxylate
Quinolinic acid
pyridine-2,3-dicarboxylate
pyridine-2,3-dicarboxylic acid
quinolinate
quinolinic acid
quln
kegg.compound:C03722
keggC:C03722
Quinolinate
2,3-Pyridinedicarboxylic acid
Pyridine-2,3-dicarboxylate
Quinolinic acid
hmdb:HMDB0000232 Quinolinic acid
2,3-Pyridinedicarboxylate
2,3-Pyridinedicarboxylic acid
3,4-Pyridinedicarboxylic acid
Pyridin-2,3-dicarbonsaeure
Pyridine-2,3-carboxylate
Pyridine-2,3-dicarboxylate
Pyridine-2,3-dicarboxylic acid
Pyridine-3,4-dicarboxylic acid
Quinolinate
Quinolinic acid, copper(2+) salt
Quinolinic acid, disodium salt
Quinolinic acid, strontium salt
pyridine-2,3-dicarboxylic acid
quinolinic acid
CHEBI:46828
chebi:46828
quinolinate(1-)
hydrogen pyridine-2,3-dicarboxylate
metacyc.compound:QUINOLINATE
metacycM:QUINOLINATE
quinolinate
2,3-pyridinedicarboxylate
2,3-pyridinedicarboxylic acid
pyridine-2,3-dicarboxylate
pyridine-2,3-dicarboxylic acid
quinolinic acid
CHEBI:132942
chebi:132942
quinolinate
quinolinate anion
quinolinic acid anion
CHEBI:16675
chebi:16675
quinolinic acid
2,3-Pyridinedicarboxylic acid
Pyridine-2,3-dicarboxylate
QUINOLINIC ACID
Quinolinic acid
pyridine-2,3-dicarboxylic acid
hmdb:HMDB00232
chebi:14975
chebi:26417
chebi:26418
chebi:44529
chebi:8663
biggM:M_quln
keggC:M_C03722
seedM:M_cpd02333
secondary/obsolete/fantasy identifier