Feedback

 

N(6)-(1,2-dicarboxylatoethyl)-AMP(4-)

Image of MNXM565
Properties
MNX_IDMNXM565
formulaC14H14N5O11P
charge-4
mass459.2638
referencechebi:57567
InChIKeyOFBHPPMPBOJXRT-DPXQIYNJSA-J
InChIInChI=1S/C14H18N5O11P/c20-7(21)1-5(14(24)25)18-11-8-12(16-3-15-11)19(4-17-8)13-10(23)9(22)6(30-13)2-29-31(26,27)28/h3-6,9-10,13,22-23H,1-2H2,(H,20,21)(H,24,25)(H,15,16,18)(H2,26,27,28)/p-4/t5?,6-,9-,10-,13-/m1/s1
SMILESO[C@@H]1[C@@H](COP([O-])([O-])=O)O[C@H]([C@@H]1O)n1cnc2c(NC(CC([O-])=O)C([O-])=O)ncnc12

This chemical compound does not exist in my selection



Occurrences of N(6)-(1,2-dicarboxylatoethyl)-AMP(4-) in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:dcamp N6-(1,2-Dicarboxyethyl)-AMP
chebi:12656
chebi:12657
chebi:15919
chebi:21857
chebi:39869
chebi:7405
Adenylosuccinate
Adenylosuccinic acid
N(6)-(1,2-dicarboxyethyl)-AMP
N-[9-(5-O-phosphono-beta-D-ribofuranosyl)-9H-purin-6-yl]aspartic acid
N6-(1,2-Dicarboxyethyl)-AMP
N6-(1,2-dicarboxyethyl)-AMP
OFBHPPMPBOJXRT-DPXQIYNJSA-N
aspartyl adenylate
chebi:22262
chebi:57567
N(6)-(1,2-dicarboxylatoethyl)-AMP tetraanion
N(6)-(1,2-dicarboxylatoethyl)-AMP(4-)
N-(1,2-dicarboxylatoethyl)-5'-O-phosphonatoadenosine
OFBHPPMPBOJXRT-DPXQIYNJSA-J
hmdb:HMDB00536
hmdb:HMDB01332
hmdb:HMDB11633
2-({9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]oxolan-2-yl]-9H-purin-6-yl}amino)butanedioic acid
Adenylsuccinic acid
adenylosuccinate
hmdb:HMDB59653 (2S)-2-({9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]oxolan-2-yl]-9H-purin-6-yl}amino)butanedioic acid
N(6)-(1,2-dicarboxyethyl)AMP
adenylosuccinic acid
kegg:C03794 Adenylosuccinate
Adenylosuccinic acid
N6-(1,2-Dicarboxyethyl)-AMP
N6-(1,2-Dicarboxyethyl)AMP
sabiork:1886 Adenylosuccinate
Adenylosuccinic acid
N(6)-(1,2-dicarboxyethyl)AMP
N6-(1,2-Dicarboxyethyl)-AMP
SAMP
deprecated:MNXM491082
deprecated:MNXM62999