Feedback

trans-ferulate

Properties
MNX_IDMNXM573
formulaC10H9O4
charge-1
mass193.17606
referencechebi:29749
Image of MNXM573
InChIKeyKSEBMYQBYZTDHS-HWKANZROSA-M
InChIInChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/p-1/b5-3+
SMILESCOc1cc(\C=C\C([O-])=O)ccc1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref35
Distinct compatimentalized reactions in models8

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0000954 trans-Ferulic acid
(2E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoate
(2E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid
(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid
(e)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoate
(e)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid
(e)-4'-Hydroxy-3'-methoxycinnamate
(e)-4'-Hydroxy-3'-methoxycinnamic acid
(e)-4-Hydroxy-3-methoxy-cinnamate
(e)-4-Hydroxy-3-methoxy-cinnamic acid
(e)-4-Hydroxy-3-methoxycinnamate
(e)-4-Hydroxy-3-methoxycinnamic acid
(e)-Ferulate
(e)-Ferulic acid
3-(4-Hydroxy-3-methoxyphenyl)propenoate
3-(4-Hydroxy-3-methoxyphenyl)propenoic acid
3-Methoxy-4-hydroxy-trans-cinnamate
3-Methoxy-4-hydroxy-trans-cinnamic acid
4-Hydroxy-3-methoxycinnamate
4-Hydroxy-3-methoxycinnamic acid
8,8'-Diferulic acid
Ferulate
Ferulic acid
Ferulic acid, (Z)-isomer
Ferulic acid, (e)-isomer
Ferulic acid, monosodium salt
Sodium ferulate
ferulic acid
trans-4-Hydroxy-3-methoxycinnamate
trans-4-Hydroxy-3-methoxycinnamic acid
trans-Ferulate
chebi:17620 ferulic acid
(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid
(E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid
(E)-4'-hydroxy-3'-methoxycinnamic acid
(E)-4-Hydroxy-3-methoxycinnamic acid
(E)-Ferulic acid
3-(4-Hydroxy-3-methoxyphenyl)propenoic acid
3-methoxy-4-hydroxy-trans-cinnamic acid
4-Hydroxy-3-methoxycinnamic acid
4-hydroxy-3-methoxycinnamic acid
Ferulic acid
trans-4-Hydroxy-3-methoxycinnamic acid
trans-Ferulic acid
chebi:29749 trans-ferulate
(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
3-methoxy-4-hydroxy-trans-cinnamate
ferulate
metacycM:FERULIC-ACID ferulate
4-hydroxy-3-methoxycinnamate
4-hydroxy-3-methoxycinnamic acid
caffeic acid 3-methyl ether
ferulic acid
seedM:cpd01059 Ferulate
3-Methoxy-4-hydroxy-trans-cinnamate
3-methoxy-4-hydroxy-trans-cinnamate
3-methoxy-4-hydroxycinnamic acid
4-Hydroxy-3-methoxycinnamic acid
4-hydroxy-3-methoxycinnamic acid
Ferulic acid
caffeic acid 3-methyl ether
ferulate
ferulic acid
frlt
biggM:fer Ferulate
keggC:C01494 Ferulate
3-Methoxy-4-hydroxy-trans-cinnamate
4-Hydroxy-3-methoxycinnamate
4-Hydroxy-3-methoxycinnamic acid
Ferulic acid
biggM:M_fer
chebi:11848
chebi:14259
chebi:14260
chebi:24029
chebi:24030
chebi:42445
chebi:5046
hmdb:HMDB0000537
hmdb:HMDB00537
hmdb:HMDB00954
keggC:M_C01494
seedM:M_cpd01059
secondary/obsolete/fantasy identifier
sabiorkM:5619 Ferulate
3-Methoxy-4-hydroxy-trans-cinnamate
4-Hydroxy-3-methoxycinnamic acid
Ferulic acid
MNXM683732is deprecated and replaced by this entry