Feedback

2-dehydro-D-gluconate

PropertiesImageOccurences in reactions
MNX_IDMNXM582Image of MNXM582
#reac
in my sandbox 0
in MNXref (generic)22
in models (compartimentalized) 11
formulaC6H9O7
charge-1
mass193.13146
referencechebi:16808
InChIKeyVBUYCZFBVCCYFD-JJYYJPOSSA-M
InChIInChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/p-1/t2-,3-,4+/m1/s1
SMILESOC[C@@H](O)[C@@H](O)[C@H](O)C(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16808
chebi:16808
2-dehydro-D-gluconate
2-Dehydro-D-gluconate
2-ketogluconate
2-ketolactonate
D-arabino-hex-2-ulosonate
bigg.metabolite:2dhglcn
biggM:2dhglcn
2-Dehydro-D-gluconate
seed.compound:cpd00480
seedM:cpd00480
2-Dehydro-D-gluconate
2-Dehydro-D-gluconic acid
2-Keto-D-gluconic acid
2-dehydro-D-gluconate
2-keto-D-gluconate
2dhglcn
alpha-D-arabino-2-Hexulosonic acid
sabiork.compound:2124
sabiorkM:2124
2-Dehydro-D-gluconate
2-Keto-D-gluconic acid
alpha-D-arabino-2-Hexulosonic acid
seed.compound:cpd03889
seedM:cpd03889
2-Keto-D-gluconic acid
kegg.compound:C06473
keggC:C06473
2-Keto-D-gluconic acid
2-Dehydro-D-gluconate
2-Dehydro-D-gluconic acid
alpha-D-arabino-2-Hexulosonic acid
CHEBI:27469
chebi:27469
2-dehydro-D-gluconic acid
2-Dehydro-D-gluconate
2-Dehydro-D-gluconic acid
2-Keto-D-gluconic acid
2-Oxogluconic acid
2-ketogluconic acid
D-arabino-hex-2-ulosonic acid
metacyc.compound:CPD-377
metacycM:CPD-377
2-keto-D-gluconate
2-dehydro-D-gluconate
chebi:1066
chebi:11559
chebi:1180
chebi:19539
chebi:19669
chebi:58512
chebi:59504
biggM:M_2dhglcn
keggC:M_C06473
seedM:M_cpd00480
seedM:M_cpd03889
secondary/obsolete/fantasy identifier