Feedback

 

2-dehydro-D-gluconate

Image of MNXM582
Properties
MNX_IDMNXM582
formulaC6H9O7
charge-1
mass193.132
referencechebi:16808
InChIKeyVBUYCZFBVCCYFD-JJYYJPOSSA-M
InChIInChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/p-1/t2-,3-,4+/m1/s1
SMILESOC[C@@H](O)[C@@H](O)[C@H](O)C(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of 2-dehydro-D-gluconate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:2dhglcn 2-Dehydro-D-gluconate
chebi:1180
chebi:19669
chebi:27469
2-Dehydro-D-gluconate
2-Dehydro-D-gluconic acid
2-Keto-D-gluconic acid
2-Oxogluconic acid
2-dehydro-D-gluconic acid
2-ketogluconic acid
D-arabino-hex-2-ulosonic acid
VBUYCZFBVCCYFD-JJYYJPOSSA-N
chebi:1066
chebi:11559
chebi:16808
chebi:19539
chebi:58512
chebi:59504
2-Dehydro-D-gluconate
2-dehydro-D-gluconate
2-ketogluconate
2-ketolactonate
D-arabino-hex-2-ulosonate
VBUYCZFBVCCYFD-JJYYJPOSSA-M
kegg:C06473 2-Dehydro-D-gluconate
2-Dehydro-D-gluconic acid
2-Keto-D-gluconic acid
alpha-D-arabino-2-Hexulosonic acid
metacyc:CPD-377 2-dehydro-D-gluconate
2-keto-D-gluconate
CPD-377
sabiork:2124 2-Dehydro-D-gluconate
2-Keto-D-gluconic acid
alpha-D-arabino-2-Hexulosonic acid
seed:cpd00480 2-Dehydro-D-gluconate
2dhglcn
seed:cpd03889 2-Keto-D-gluconic acid
alpha-D-arabino-2-Hexulosonic acid
deprecated:MNXM1981