Feedback

2-dehydro-D-gluconate

Properties
MNX_IDMNXM582
formulaC6H9O7
charge-1
mass193.13146
referencechebi:16808
Image of MNXM582
InChIKeyVBUYCZFBVCCYFD-JJYYJPOSSA-M
InChIInChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/p-1/t2-,3-,4+/m1/s1
SMILESOC[C@@H](O)[C@@H](O)[C@H](O)C(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref22
Distinct compatimentalized reactions in models11

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00480 2-Dehydro-D-gluconate
2-Dehydro-D-gluconic acid
2-Keto-D-gluconic acid
2-dehydro-D-gluconate
2-keto-D-gluconate
2dhglcn
alpha-D-arabino-2-Hexulosonic acid
chebi:16808 2-dehydro-D-gluconate
2-Dehydro-D-gluconate
2-ketogluconate
2-ketolactonate
D-arabino-hex-2-ulosonate
biggM:2dhglcn 2-Dehydro-D-gluconate
biggM:M_2dhglcn
chebi:1066
chebi:11559
chebi:1180
chebi:19539
chebi:19669
chebi:58512
chebi:59504
keggC:M_C06473
seedM:M_cpd00480
seedM:M_cpd03889
secondary/obsolete/fantasy identifier
keggC:C06473 2-Keto-D-gluconic acid
2-Dehydro-D-gluconate
2-Dehydro-D-gluconic acid
alpha-D-arabino-2-Hexulosonic acid
seedM:cpd03889 2-Keto-D-gluconic acid
chebi:27469 2-dehydro-D-gluconic acid
2-Dehydro-D-gluconate
2-Dehydro-D-gluconic acid
2-Keto-D-gluconic acid
2-Oxogluconic acid
2-ketogluconic acid
D-arabino-hex-2-ulosonic acid
sabiorkM:2124 2-Dehydro-D-gluconate
2-Keto-D-gluconic acid
alpha-D-arabino-2-Hexulosonic acid
metacycM:CPD-377 2-keto-D-gluconate
2-dehydro-D-gluconate
MNXM1981is deprecated and replaced by this entry