Feedback

allantoate

PropertiesImageOccurences in reactions
MNX_IDMNXM584Image of MNXM584
#reac
in my sandbox 0
in MNXref (generic)11
in models (compartimentalized) 8
formulaC4H7N4O4
charge-1
mass175.12294
referencechebi:17536
InChIKeyNUCLJNSWZCHRKL-UHFFFAOYSA-M
InChIInChI=1S/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12)/p-1
SMILESNC(=O)NC(NC(N)=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17536
chebi:17536
allantoate
bis(carbamoylamino)acetate
bis[(aminocarbonyl)amino]acetate
diureidoacetate
bigg.metabolite:alltt
biggM:alltt
Allantoate
sabiork.compound:1873
sabiorkM:1873
kegg.compound:C00499
keggC:C00499
Allantoate
Allantoic acid
seed.compound:cpd00388
seedM:cpd00388
Allantoate
Allantoic acid
acetic acid, bis((aminocarbonyl)amino)-
allantoate
allantoic acid
alltt
hmdb:HMDB0001209 Allantoic acid
2,2-bis(carbamoylamino)acetic acid
Allantoate
Allantoic acid, monosodium salt
Bis[(aminocarbonyl)amino]acetate
Bis[(aminocarbonyl)amino]acetic acid
Diureidoacetate
Diureidoacetic acid
allantoic acid
metacyc.compound:ALLANTOATE
metacycM:ALLANTOATE
allantoate
acetic acid, bis((aminocarbonyl)amino)-
allantoic acid
CHEBI:30837
chebi:30837
allantoic acid
Allantoic acid
bis(carbamoylamino)acetic acid
bis[(aminocarbonyl)amino]acetic acid
diureidoacetic acid
hmdb:HMDB01209
chebi:13760
chebi:22352
chebi:22353
chebi:2593
biggM:M_alltt
keggC:M_C00499
seedM:M_cpd00388
secondary/obsolete/fantasy identifier