Feedback

allantoate

Properties
MNX_IDMNXM584
formulaC4H7N4O4
charge-1
mass175.12294
referencechebi:17536
Image of MNXM584
InChIKeyNUCLJNSWZCHRKL-UHFFFAOYSA-M
InChIInChI=1S/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12)/p-1
SMILESNC(=O)NC(NC(N)=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models8

Similar chemical compounds in external resources
IdentifierDescription
chebi:30837 allantoic acid
Allantoic acid
bis(carbamoylamino)acetic acid
bis[(aminocarbonyl)amino]acetic acid
diureidoacetic acid
biggM:alltt Allantoate
metacycM:ALLANTOATE allantoate
acetic acid, bis((aminocarbonyl)amino)-
allantoic acid
hmdb:HMDB0001209 Allantoic acid
2,2-bis(carbamoylamino)acetic acid
Allantoate
Allantoic acid, monosodium salt
Bis[(aminocarbonyl)amino]acetate
Bis[(aminocarbonyl)amino]acetic acid
Diureidoacetate
Diureidoacetic acid
allantoic acid
chebi:17536 allantoate
bis(carbamoylamino)acetate
bis[(aminocarbonyl)amino]acetate
diureidoacetate
seedM:cpd00388 Allantoate
Allantoic acid
acetic acid, bis((aminocarbonyl)amino)-
allantoate
allantoic acid
alltt
biggM:M_alltt
chebi:13760
chebi:22352
chebi:22353
chebi:2593
hmdb:HMDB01209
keggC:M_C00499
seedM:M_cpd00388
secondary/obsolete/fantasy identifier
keggC:C00499
sabiorkM:1873
Allantoate
Allantoic acid