Feedback

(R)-pantoate

PropertiesImageOccurences in reactions
MNX_IDMNXM593Image of MNXM593
#reac
in my sandbox 0
in MNXref (generic)27
in models (compartimentalized) 2
formulaC6H11O4
charge-1
mass147.14914
referencechebi:15980
InChIKeyOTOIIPJYVQJATP-BYPYZUCNSA-M
InChIInChI=1S/C6H12O4/c1-6(2,3-7)4(8)5(9)10/h4,7-8H,3H2,1-2H3,(H,9,10)/p-1/t4-/m0/s1
SMILESCC(C)(CO)[C@@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15980
chebi:15980
(R)-pantoate
(2R)-2,4-dihydroxy-3,3-dimethylbutanoate
(R)-Pantoate
PANTOATE
bigg.metabolite:pant__R
biggM:pant__R
(R)-Pantoate
sabiork.compound:5130
sabiorkM:5130
kegg.compound:C00522
keggC:C00522
(R)-Pantoate
Pantoate
Pantoic acid
metacyc.compound:L-PANTOATE
metacycM:L-PANTOATE
(R)-pantoate
L-pantoate
pantoate
CHEBI:18697
chebi:18697
(R)-pantoic acid
(2R)-2,4-dihydroxy-3,3-dimethylbutanoic acid
Pantoate
Pantoic acid
sabiork.compound:21325
sabiorkM:21325
D-Pantoate
seed.compound:cpd00408
seedM:cpd00408
Pantoate
(R)-Pantoate
(R)-pantoate
L-pantoate
Pantoic acid
R-Pantoate
pant-R
pantoate
CHEBI:14737
chebi:14737
pantoic acid
2,4-dihydroxy-3,3-dimethylbutanoic acid
Pantoate
Pantoic acid
chebi:11006
chebi:18695
chebi:18696
chebi:350
chebi:44662
biggM:M_pant__R
keggC:M_C00522
seedM:M_cpd00408
secondary/obsolete/fantasy identifier