Feedback

3-sulfopyruvate

PropertiesImageOccurences in reactions
MNX_IDMNXM594Image of MNXM594
#reac
in my sandbox 0
in MNXref (generic)10
in models (compartimentalized) 10
formulaC3H2O6S
charge-2
mass166.11038
referencechebi:57940
InChIKeyBUTHMSUEBYPMKJ-UHFFFAOYSA-L
InChIInChI=1S/C3H4O6S/c4-2(3(5)6)1-10(7,8)9/h1H2,(H,5,6)(H,7,8,9)/p-2
SMILES[O-]C(=O)C(=O)CS([O-])(=O)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57940
chebi:57940
3-sulfopyruvate
2-oxo-3-sulfonatopropanoate
3-sulfonatopyruvate
3-sulfonatopyruvate dianion
3-sulfonatopyruvate(2-)
bigg.metabolite:3spyr
biggM:3spyr
3-Sulfopyruvate
sabiork.compound:2800
sabiorkM:2800
kegg.compound:C05528
keggC:C05528
3-Sulfopyruvate
3-Sulfopyruvic acid
seed.compound:cpd03285
seedM:cpd03285
3-Sulfopyruvate
3-Sulfopyruvic acid
3-sulfopyruvate
3spyr
sulfopyruvate
hmdb:HMDB0004045 3-Sulfopyruvic acid
2-Carboxy-2-oxoethanesulfonate
2-Carboxy-2-oxoethanesulfonic acid
2-Carboxy-2-oxoethanesulphonate
2-Carboxy-2-oxoethanesulphonic acid
2-oxo-3-SulfO-propanoate
2-oxo-3-SulfO-propanoic acid
2-oxo-3-Sulfopropanoate
2-oxo-3-Sulfopropanoic acid
2-oxo-3-sulfopropanoic acid
3-Sulfonatopyruvate
3-Sulfopyruvate
3-Sulphopyruvate
3-Sulphopyruvic acid
SULFopyruvATE
Sulfopyruvic acid
Sulphopyruvate
Sulphopyruvic acid
b-Sulfopyruvate
b-Sulfopyruvic acid
b-Sulphopyruvate
b-Sulphopyruvic acid
beta-Sulfopyruvate
beta-Sulfopyruvic acid
beta-Sulphopyruvate
beta-Sulphopyruvic acid
beta-sulfopyruvate
beta-sulfopyruvic acid
beta-sulphopyruvate
beta-sulphopyruvic acid
sulfopyruvate
metacyc.compound:CPD-380
metacycM:CPD-380
3-sulfopyruvate
3-Sulfopyruvic acid
sulfopyruvate
CHEBI:16894
chebi:16894
3-sulfopyruvic acid
2-carboxy-2-oxoethanesulfonic acid
2-oxo-3-sulfopropanoic acid
3-Sulfopyruvate
3-Sulfopyruvic acid
SULFOPYRUVATE
beta-sulfopyruvic acid
hmdb:HMDB0060174
hmdb:HMDB04045
hmdb:HMDB60174
chebi:11891
chebi:1669
chebi:45736
biggM:M_3spyr
keggC:M_C05528
seedM:M_cpd03285
secondary/obsolete/fantasy identifier