Feedback

3-sulfopyruvate

Properties
MNX_IDMNXM594
formulaC3H2O6S
charge-2
mass166.11038
referencechebi:57940
Image of MNXM594
InChIKeyBUTHMSUEBYPMKJ-UHFFFAOYSA-L
InChIInChI=1S/C3H4O6S/c4-2(3(5)6)1-10(7,8)9/h1H2,(H,5,6)(H,7,8,9)/p-2
SMILES[O-]C(=O)C(=O)CS([O-])(=O)=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref10
Distinct compatimentalized reactions in models10

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-380 3-sulfopyruvate
3-Sulfopyruvic acid
sulfopyruvate
chebi:16894 3-sulfopyruvic acid
2-carboxy-2-oxoethanesulfonic acid
2-oxo-3-sulfopropanoic acid
3-Sulfopyruvate
3-Sulfopyruvic acid
SULFOPYRUVATE
beta-sulfopyruvic acid
biggM:M_3spyr
chebi:11891
chebi:1669
chebi:45736
hmdb:HMDB0060174
hmdb:HMDB04045
hmdb:HMDB60174
keggC:M_C05528
seedM:M_cpd03285
secondary/obsolete/fantasy identifier
keggC:C05528
sabiorkM:2800
3-Sulfopyruvate
3-Sulfopyruvic acid
chebi:57940 3-sulfopyruvate
2-oxo-3-sulfonatopropanoate
3-sulfonatopyruvate
3-sulfonatopyruvate dianion
3-sulfonatopyruvate(2-)
seedM:cpd03285 3-Sulfopyruvate
3-Sulfopyruvic acid
3-sulfopyruvate
3spyr
sulfopyruvate
biggM:3spyr 3-Sulfopyruvate
hmdb:HMDB0004045 3-Sulfopyruvic acid
2-Carboxy-2-oxoethanesulfonate
2-Carboxy-2-oxoethanesulfonic acid
2-Carboxy-2-oxoethanesulphonate
2-Carboxy-2-oxoethanesulphonic acid
2-oxo-3-SulfO-propanoate
2-oxo-3-SulfO-propanoic acid
2-oxo-3-Sulfopropanoate
2-oxo-3-Sulfopropanoic acid
2-oxo-3-sulfopropanoic acid
3-Sulfonatopyruvate
3-Sulfopyruvate
3-Sulphopyruvate
3-Sulphopyruvic acid
SULFopyruvATE
Sulfopyruvic acid
Sulphopyruvate
Sulphopyruvic acid
b-Sulfopyruvate
b-Sulfopyruvic acid
b-Sulphopyruvate
b-Sulphopyruvic acid
beta-Sulfopyruvate
beta-Sulfopyruvic acid
beta-Sulphopyruvate
beta-Sulphopyruvic acid
beta-sulfopyruvate
beta-sulfopyruvic acid
beta-sulphopyruvate
beta-sulphopyruvic acid
sulfopyruvate