Feedback

Iminoaspartate

Properties
MNX_IDMNXM599
formulaC4H3NO4
charge-2
mass129.07096
referencebiggM:iasp
Image of MNXM599
InChIKeyNMUOATVLLQEYHI-DJWKRKHSSA-L
InChIInChI=1S/C4H5NO4/c5-2(4(8)9)1-3(6)7/h5H,1H2,(H,6,7)(H,8,9)/p-2/b5-2-
SMILES[O-]C(=O)CC(=N)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref15
Distinct compatimentalized reactions in models11

Similar chemical compounds in external resources
IdentifierDescription
chebi:58831 iminoaspartate
2-iminobutanedioate
2-iminosuccinate
seedM:cpd03470 Iminoaspartate
2-iminobutanedioate
2-iminosuccinate
Iminoaspartic acid
Iminosuccinate
alpha-iminosuccinate
iasp
iminoaspartate
metacycM:IMINOASPARTATE 2-iminosuccinate
2-iminobutanedioate
alpha-iminosuccinate
iminoaspartate
keggC:C05840 Iminoaspartate
Iminoaspartic acid
Iminosuccinate
biggM:iasp Iminoaspartate
biggM:M_iasp
chebi:24784
chebi:5878
hmdb:HMDB01131
keggC:M_C05840
seedM:M_cpd03470
secondary/obsolete/fantasy identifier
chebi:50616 iminoaspartic acid
2-iminobutanedioic acid
Iminoaspartate
Iminoaspartic acid
Iminosuccinate
iminosuccinate
iminosuccinic acid
chebi:77875 iminosuccinate
iminoaspartate(1-)
hmdb:HMDB0001131 Iminoaspartic acid
2-iminobutanedioic acid
Iminoaspartate
Iminosuccinate
Iminosuccinic acid
alpha-Iminosuccinate
imino-Butanedioate
imino-Butanedioic acid
iminosuccinic acid
lipidmaps:LMFA01170110 Iminoaspartic acid
2-imino-butanedioic acid
MNXM163150is deprecated and replaced by this entry