Feedback

iminosuccinate

PropertiesImageOccurences in reactions
MNX_IDMNXM599Image of MNXM599
#reac
in my sandbox 0
in MNXref (generic)15
in models (compartimentalized) 11
formulaC4H4NO4
charge-1
mass130.0789
referencechebi:77875
InChIKeyNMUOATVLLQEYHI-UHFFFAOYSA-M
InChIInChI=1S/C4H5NO4/c5-2(4(8)9)1-3(6)7/h5H,1H2,(H,6,7)(H,8,9)/p-1
SMILES[O-]C(=O)CC(=[NH2+])C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:77875
chebi:77875
iminosuccinate
iminoaspartate(1-)
metacyc.compound:IMINOASPARTATE
metacycM:IMINOASPARTATE
2-iminosuccinate
2-iminobutanedioate
alpha-iminosuccinate
iminoaspartate
bigg.metabolite:iasp
biggM:iasp
Iminoaspartate
seed.compound:cpd03470
seedM:cpd03470
Iminoaspartate
2-iminobutanedioate
2-iminosuccinate
Iminoaspartic acid
Iminosuccinate
alpha-iminosuccinate
iasp
iminoaspartate
kegg.compound:C05840
keggC:C05840
Iminoaspartate
Iminoaspartic acid
Iminosuccinate
lipidmaps:LMFA01170110
lipidmapsM:LMFA01170110
Iminoaspartic acid
2-imino-butanedioic acid
hmdb:HMDB0001131 Iminoaspartic acid
2-iminobutanedioic acid
Iminoaspartate
Iminosuccinate
Iminosuccinic acid
alpha-Iminosuccinate
imino-Butanedioate
imino-Butanedioic acid
iminosuccinic acid
CHEBI:58831
chebi:58831
iminoaspartate
2-iminobutanedioate
2-iminosuccinate
CHEBI:50616
chebi:50616
iminoaspartic acid
2-iminobutanedioic acid
Iminoaspartate
Iminoaspartic acid
Iminosuccinate
iminosuccinate
iminosuccinic acid
hmdb:HMDB01131
chebi:24784
chebi:5878
biggM:M_iasp
keggC:M_C05840
seedM:M_cpd03470
secondary/obsolete/fantasy identifier