Feedback

shikimate

Properties
MNX_IDMNXM602
formulaC7H9O5
charge-1
mass173.14336
referencechebi:36208
Image of MNXM602
InChIKeyJXOHGGNKMLTUBP-HSUXUTPPSA-M
InChIInChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/p-1/t4-,5-,6-/m1/s1
SMILESO[C@@H]1CC(=C[C@@H](O)[C@H]1O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref25
Distinct compatimentalized reactions in models9

Similar chemical compounds in external resources
IdentifierDescription
metacycM:SHIKIMATE shikimate
(3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
3,4,5-trihydroxy-1-cyclohexene-1-carboxylate
shikimic acid
seedM:cpd00383 Shikimate
(3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
1-cyclohexene-1-carboxylic acid, 3,4,5-trihydroxy-
3,4,5-Trihydroxy-1-cyclohexenecarboxylic acid
3,4,5-trihydroxy-1-cyclohexene-1-carboxylate
Shikimic acid
shikimate
shikimic acid
skm
sabiorkM:27314 (-)-Shikimate
hmdb:HMDB0130150 3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid
shikimate
keggC:C00493
sabiorkM:5117
Shikimate
3,4,5-Trihydroxy-1-cyclohexenecarboxylic acid
Shikimic acid
biggM:M_skm
chebi:15083
chebi:26662
chebi:26663
chebi:26664
chebi:45740
chebi:9133
hmdb:HMDB03070
keggC:M_C00493
seedM:M_cpd00383
secondary/obsolete/fantasy identifier
chebi:132329 3,4,5-trihydroxy-1-cyclohexene-1-carboxylic acid
3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid
biggM:skm Shikimate
chebi:36208 shikimate
(3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
chebi:16119
reactome:R-ALL-964932
shikimic acid
(3R,4S,5R)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid
3,4,5-Trihydroxy-1-cyclohexenecarboxylic acid
3alpha,4alpha,5beta-trihydroxy-1-cyclohexene-1-carboxylic acid
L-shikimic acid
Shikimate
Shikimic acid
[3R-(3alpha,4alpha,5beta)]-3,4,5-trihydroxy-1-cyclohexene-1-carboxylic acid
hmdb:HMDB0003070 Shikimic acid
(-)-Shikimate
(-)-Shikimic acid
(-)-shikimate
(3R,4S,5R)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid
3,4,5-Trihydroxy-1-cyclohexenecarboxylate
3,4,5-Trihydroxy-1-cyclohexenecarboxylic acid
3a,4a,5b-Trihydroxy-1-cyclohexene-1-carboxylate
3a,4a,5b-Trihydroxy-1-cyclohexene-1-carboxylic acid
3alpha,4alpha,5beta-Trihydroxy-1-cyclohexene-1-carboxylate
3alpha,4alpha,5beta-Trihydroxy-1-cyclohexene-1-carboxylic acid
3alpha,4alpha,5beta-trihydroxy-1-cyclohexene-1-carboxylate
3alpha,4alpha,5beta-trihydroxy-1-cyclohexene-1-carboxylic acid
Acid, shikimic
L-Shikimate
L-Shikimic acid
Shikimate
Skikimate
Skikimic acid
[3R-(3a,4a,5b)]-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylate
[3R-(3a,4a,5b)]-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid
[3R-(3alpha,4alpha,5beta)]-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylate
[3R-(3alpha,4alpha,5beta)]-3,4,5-Trihydroxy-1-cyclohexene-1-carboxylic acid
[3R-(3alpha,4alpha,5beta)]-3,4,5-trihydroxy-1-cyclohexene-1-carboxylate
[3R-(3alpha,4alpha,5beta)]-3,4,5-trihydroxy-1-cyclohexene-1-carboxylic acid
MNXM165257is deprecated and replaced by this entry
MNXM481951is deprecated and replaced by this entry
MNXM92656is deprecated and replaced by this entry