Feedback

3-dehydroshikimate

PropertiesImageOccurences in reactions
MNX_IDMNXM611Image of MNXM611
#reac
in my sandbox 0
in MNXref (generic)23
in models (compartimentalized) 5
formulaC7H7O5
charge-1
mass171.12748
referencechebi:16630
InChIKeySLWWJZMPHJJOPH-PHDIDXHHSA-M
InChIInChI=1S/C7H8O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,5-6,9-10H,2H2,(H,11,12)/p-1/t5-,6-/m1/s1
SMILESO[C@@H]1CC(=CC(=O)[C@H]1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-964941
reactomeM:R-ALL-964941
CHEBI:16630
chebi:16630
3-dehydroshikimate
(4S,5R)-4,5-dihydroxy-3-oxocyclohex-1-ene-1-carboxylate
sabiork.compound:27313
sabiorkM:27313
(-)-3-Dehydroshikimate
bigg.metabolite:3dhsk
biggM:3dhsk
sabiork.compound:6290
sabiorkM:6290
kegg.compound:C02637
keggC:C02637
3-Dehydroshikimate
seed.compound:cpd01716
seedM:cpd01716
3-Dehydroshikimate
3-dehydro-shikimate
3-dehydroshikimate
3-dehydroshikimic acid
3dhsk
5-dehydroshikimate
5-dehydroshikimic acid
metacyc.compound:3-DEHYDRO-SHIKIMATE
metacycM:3-DEHYDRO-SHIKIMATE
3-dehydroshikimate
3-dehydroshikimic acid
5-dehydroshikimate
5-dehydroshikimic acid
CHEBI:30918
chebi:30918
3-dehydroshikimic acid
(-)-3-dehydroshikimic acid
(4S,5R)-4,5-dihydroxy-3-oxocyclohex-1-ene-1-carboxylic acid
3-Dehydroshikimate
5-Dehydroshikimate
5-dehydroshikimic acid
chebi:11782
chebi:12123
chebi:1488
chebi:19998
chebi:19999
chebi:2052
chebi:20566
chebi:42005
biggM:M_3dhsk
keggC:M_C02637
seedM:M_cpd01716
secondary/obsolete/fantasy identifier