Feedback

folate

PropertiesImageOccurences in reactions
MNX_IDMNXM617Image of MNXM617
#reac
in my sandbox 0
in MNXref (generic)20
in models (compartimentalized) 16
formulaC19H17N7O6
charge-2
mass439.38186
referencechebi:62501
InChIKeyOVBPIULPVIDEAO-LBPRGKRZSA-L
InChIInChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/p-2/t12-/m0/s1
SMILESNc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)nc2c(=O)[nH]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:62501
chebi:62501
folate
N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamate(2-)
folate(2-)
bigg.metabolite:fol
biggM:fol
Folate
seed.compound:cpd00393
seedM:cpd00393
Folate
FOL
Folic acid
Pteroylglutamic acid
fol
folate
folic acid
sabiork.compound:2063
sabiorkM:2063
kegg.compound:C00504
keggC:C00504
Folate
Folic acid
Pteroylglutamic acid
kegg.drug:D00070
keggD:D00070
Folic acid (JP17/USP/INN)
Folicet (TN)
hmdb:HMDB0000121 Folic acid
(2S)-2-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid
Acifolic
Cytofol
Dosfolat b activ
Folacid
Folacin
Folate
Folbal
Folcidin
Foldine
Folettes
Foliamin
Folic acid, (D)-isomer
Folic acid, (DL)-isomer
Folic acid, calcium salt (1:1)
Folic acid, monopotassium salt
Folic acid, monosodium salt
Folic acid, potassium salt
Folic acid, sodium salt
Folicet
Folipac
Folsaeure
Folsan
Folsaure
Folsav
Folvite
Incafolic
Liver lactobacillus casei factor
Millafol
N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid
N-Pteroyl-L-glutamate
N-Pteroyl-L-glutamic acid
N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamate
N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid
N-[4-[[(2-amino-3,4-dihydro-4-oxo-6-Pteridinyl)methyl]amino]benzoyl]-L-glutamic acid
PGA
PteGlu
Pteroyl-L-glutamate
Pteroyl-L-glutamic acid
Pteroyl-L-monoglutamate
Pteroyl-L-monoglutamic acid
Pteroylglutamate
Pteroylglutamic acid
Pteroylmonoglutamic acid
Vitamin BC
Vitamin b9
Vitamin be
Vitamin m
b9, Vitamin
folate
metacyc.compound:CPD-12826
metacycM:CPD-12826
folate
folic acid
reactome:R-ALL-197965
reactomeM:R-ALL-197965
reactome:R-ALL-200716
reactomeM:R-ALL-200716
CHEBI:27470
chebi:27470
folic acid
FOLIC ACID
Folate
Folic acid
Folsaeure
N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid
N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid
N-pteroyl-L-glutamic acid
PGA
PteGlu
Pteroylglutamic acid
pteroyl-L-glutamic acid
pteroyl-L-monoglutamic acid
vitamin Bc
vitamin M
hmdb:HMDB00121
chebi:24075
chebi:42610
chebi:5140
chebi:569217
biggM:M_fol
keggC:M_C00504
keggD:M_D00070
seedM:M_cpd00393
secondary/obsolete/fantasy identifier