Feedback

7-methylxanthine

PropertiesImageOccurences in reactions
MNX_IDMNXM628Image of MNXM628
#reac
in my sandbox 0
in MNXref (generic)15
in models (compartimentalized) 1
formulaC6H6N4O2
charge0
mass166.1376
referencechebi:48991
InChIKeyPFWLFWPASULGAN-UHFFFAOYSA-N
InChIInChI=1S/C6H6N4O2/c1-10-2-7-4-3(10)5(11)9-6(12)8-4/h2H,1H3,(H2,8,9,11,12)
SMILESCn1cnc2[nH]c(=O)[nH]c(=O)c12
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:48991
chebi:48991
7-methylxanthine
3,7-dihydro-7-methyl-1H-purine-2,6-dione
7-Methylxanthin
7-methyl-3,7-dihydro-1H-purine-2,6-dione
Heteroxanthin
Heteroxanthine
sabiork.compound:30048
sabiorkM:30048
envipath:...4b47da9d2641
envipathM:...4b47da9d2641
kegg.compound:C16353
keggC:C16353
7-Methylxanthine
hmdb:HMDB0001991 7-Methylxanthine
2,6-Dihydroxy-7-methylpurine
3,7-dihydro-7-Methyl-1H-purine-2,6-dione
7-Methyl-3,7-dihydro-1H-purine-2,6-dione
7-Methyl-7H-purine-2,6-diol
7-Methylxanthin
7-Methylxanthine, 7-(13)C-labeled
7-methyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione
7-methylxanthine
Heteroxanthin
Heteroxanthine
Methylxanthine
seed.compound:cpd15069
seedM:cpd15069
7-Methylxanthine
3,7-dihydro-7-methyl-1H-purine-2,6-dione
7-methylxanthine
heteroxanthine
metacyc.compound:7-METHYLXANTHINE
metacycM:7-METHYLXANTHINE
7-methylxanthine
3,7-dihydro-7-methyl-1H-purine-2,6-dione
heteroxanthine
hmdb:HMDB01991
keggC:M_C16353
seedM:M_cpd15069
secondary/obsolete/fantasy identifier