Feedback

 

(9Z)-tetradecenoate

Image of MNXM62836
Properties
MNX_IDMNXM62836
formulaC14H25O2
charge-1
mass225.3476
referencechebi:32370
InChIKeyYWWVWXASSLXJHU-WAYWQWQTSA-M
InChIInChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/p-1/b6-5-
SMILESCCCC\C=C/CCCCCCCC([O-])=O

This chemical compound does not exist in my selection



Occurrences of (9Z)-tetradecenoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:25454
chebi:27781
chebi:7058
(9Z)-Tetradecenoic acid
(9Z)-tetradec-9-enoic acid
(Z)-Tetradec-9-enoic acid
9-Tetradecenoic acid
9Z-tetradecenoic acid
Myristoleic acid
YWWVWXASSLXJHU-WAYWQWQTSA-N
cis-9-tetradecenoic acid
cis-Delta(9)-tetradecenoic acid
cis-tetradec-9-enoic acid
myristoleic acid
chebi:32370 (14:1n5)
(9Z)-tetradec-9-enoate
(9Z)-tetradecenoate
(Z)-tetradec-9-enoate
9-tetradecenoate
9Z-tetradecenoate
YWWVWXASSLXJHU-WAYWQWQTSA-M
cis-9-tetradecenoate
cis-Delta(9)-tetradecenoate
myristoleate
hmdb:HMDB02000 (9Z)-tetradec-9-enoic acid
Myristoleic acid
myristoleic acid
kegg:C08322
seed:cpd05237
(9Z)-Tetradecenoic acid
(Z)-Tetradec-9-enoic acid
9-Tetradecenoic acid
Myristoleic acid
lipidmaps:LMFA01030051 9Z-tetradecenoic acid
C14:1n-5
Myristoleic acid
cis-9-tetradecenoic acid
lipidmaps:LMFA01030051
sabiork:10421 (Z)-Tetradec-9-enoic acid
9-Tetradecenoic acid
Myristoleic acid
slm:000000856 (9Z)-tetradecenoate
Myristoleate
deprecated:MNXM95346