Feedback

(2S,6S)-2,6-diaminoheptanedioate

PropertiesImageOccurences in reactions
MNX_IDMNXM644Image of MNXM644
#reac
in my sandbox 0
in MNXref (generic)19
in models (compartimentalized) 18
formulaC7H14N2O4
charge0
mass190.19714
referencechebi:57609
InChIKeyGMKMEZVLHJARHF-WHFBIAKZSA-N
InChIInChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1
SMILES[NH3+][C@@H](CCC[C@H]([NH3+])C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57609
chebi:57609
(2S,6S)-2,6-diaminoheptanedioate
(2S,6S)-2,6-diaminopimelic acid dizwitterion
(2S,6S)-2,6-diammonioheptanedioate
(2S,6S)-2,6-diazaniumylheptanedioate
(S,S)-2,6-diaminopimelic acid dizwitterion
L,L-2,6-diaminopimelic acid dizwitterion
LL-2,6-diaminopimelic acid dizwitterion
hmdb:HMDB0001370 Diaminopimelic acid
( (R*,s*)-2,6-diamino-heptanedioate
( (R*,s*)-2,6-diamino-heptanedioic acid
(2R,6S)-2,6-diamino-Heptanedioate
(2R,6S)-2,6-diamino-Heptanedioic acid
(2S,6S)-2,6-diaminoheptanedioic acid
(R*,s*)-2,6-diamino-heptanedioate
(R*,s*)-2,6-diamino-heptanedioic acid
(S,S)-2,6-Diaminopimelate
(S,S)-2,6-Diaminopimelic acid
(S-(R*,r*))-2,6-diaminoheptanedioate
(S-(R*,r*))-2,6-diaminoheptanedioic acid
2,6-Diaminoheptanedioate
2,6-Diaminoheptanedioic acid
2,6-Diaminopimelate
2,6-Diaminopimelic acid
2,6-diamino-Heptanedioate
2,6-diamino-Heptanedioic acid
Acid, diaminopimelic
D,L-Diaminopimelate
D,L-meso-Diaminoheptanedioate
D,L-meso-Diaminoheptanedioic acid
DAPA
DL-2,6-Diaminoheptanedioate
DL-2,6-Diaminoheptanedioic acid
DL-2,6-Diaminopimelate
DL-2,6-Diaminopimelic acid
Diaminopimelate
L,L-2,6-Diaminoheptanedioate
L,L-2,6-Diaminoheptanedioic acid
L,L-2,6-Diaminopimelate
L,L-2,6-Diaminopimelic acid
L,L-Diaminopimelate
LL-2,6-Diaminoheptanedioate
LL-2,6-Diaminoheptanedioic acid
LL-2,6-Diaminopimelate
LL-2,6-Diaminopimelic acid
a,A'-diaminopimelate
a,A'-diaminopimelic acid
a,e-Diaminopimelate
a,e-Diaminopimelic acid
diamino-pimelic acid
meso-1-alpha,epsilon-Diaminopimelate
meso-2,6-Diaminoheptanedioate
meso-2,6-Diaminoheptanedioic acid
meso-2,6-diamino-Heptanedioate
meso-2,6-diamino-Heptanedioic acid
meso-Diaminoheptanedioate
meso-Diaminoheptanedioic acid
meso-Diaminopimelate
meso-alpha,Alpha'-diaminopimelate
meso-alpha,Alpha'-diaminopimelic acid
meso-alpha,epsilon-Diaminopimelate
meso-alpha,epsilon-Diaminopimelic acid
metacyc.compound:LL-DIAMINOPIMELATE
metacycM:LL-DIAMINOPIMELATE
L,L-diaminopimelate
L,L-2,6-diaminoheptanedioate
L,L-2,6-diaminopimelate
L,L-A2pm
L,L-DAP
bigg.metabolite:26dap_LL
biggM:26dap_LL
LL-2,6-Diaminoheptanedioate
sabiork.compound:5171
sabiorkM:5171
kegg.compound:C00666
keggC:C00666
LL-2,6-Diaminoheptanedioate
LL-2,6-Diaminopimelate
LL-2,6-Diaminopimelic acid
seed.compound:cpd00504
seedM:cpd00504
LL-2,6-Diaminopimelate
26dap-LL
L,L-2,6-diaminoheptanedioate
L,L-2,6-diaminopimelate
L,L-A2pm
L,L-DAP
L,L-diaminopimelate
LL-2,6-Diaminoheptanedioate
LL-2,6-Diaminopimelic acid
LL-2-6-Diaminoheptanedioate
CHEBI:47031
chebi:47031
LL-2,6-diaminopimelate(2-)
(2S,6S)-2,6-diaminoheptanedioate
(S,S)-2,6-diaminopimelate(2-)
LL-2,6-diaminopimelate
CHEBI:16026
chebi:16026
LL-2,6-diaminopimelic acid
(2S,6S)-2,6-diaminoheptanedioic acid
(S,S)-2,6-diaminopimelic acid
(S-(R*,R*))-2,6-diaminoheptanedioic acid
L,L-2,6-diaminopimelic acid
LL-2,6-Diaminoheptanedioate
LL-2,6-Diaminopimelate
LL-2,6-Diaminopimelic acid
lipidmaps:LMFA01170102
lipidmapsM:LMFA01170102
diamino-pimelic acid
2,6-diamino-heptanedioic acid
hmdb:HMDB01370
chebi:13192
chebi:21428
chebi:21429
chebi:6341
biggM:M_26dap_LL
keggC:M_C00666
seedM:M_cpd00504
secondary/obsolete/fantasy identifier