Feedback

 

3,4-dihydroxyphenylacetate

Image of MNXM645
Properties
MNX_IDMNXM645
formulaC8H7O4
charge-1
mass167.1393
referencechebi:17612
InChIKeyCFFZDZCDUFSOFZ-UHFFFAOYSA-M
InChIInChI=1S/C8H8O4/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1
SMILESOc1ccc(CC([O-])=O)cc1O

This chemical compound does not exist in my selection



Occurrences of 3,4-dihydroxyphenylacetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:34dhpacet
bigg:34dhpha
3-4-Dihydroxyphenylacetate
chebi:11696
chebi:11697
chebi:17612
chebi:19889
(3,4-dihydroxyphenyl)acetate
3,4-dihydroxyphenylacetate
CFFZDZCDUFSOFZ-UHFFFAOYSA-M
homoprotocatechuate
chebi:1386
chebi:41936
chebi:41941
(3,4-dihydroxyphenyl)acetic acid
2-(3,4-DIHYDROXYPHENYL)ACETIC ACID
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetic acid
3,4-dihydroxyphenylacetic acid
CFFZDZCDUFSOFZ-UHFFFAOYSA-N
dopacetic acid
homoprotocatechuic acid
envipath:...c652a8465767 3,4-Dihydroxyphenylacetate
envipath:...976a15bf65aa compound 1005
hmdb:HMDB01336 2-(3,4-dihydroxyphenyl)acetic acid
3,4 dihydroxyphenylacetic acid
3,4-Dihydroxybenzeneacetic acid
kegg:C01161 3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenylacetic acid
Homoprotocatechuate
metacyc:CPD-782 3,4-dihydroxyphenylacetate
3,4-dihydroxyphenylacetic acid
CPD-782
dihydroxyphenylacetic acid
homoprotocatechuate
sabiork:5413 3,4-Dihydroxyphenyl acetate
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenylacetic acid
Homoprotocatechuate
seed:cpd00854 3,4-Dihydroxyphenyl acetate
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenylacetic acid
34dhpha
Homoprotocatechuate
deprecated:MNXM147377
deprecated:MNXM481994
deprecated:MNXM723718