Feedback

3,4-dihydroxyphenylacetate

Properties
MNX_IDMNXM645
formulaC8H7O4
charge-1
mass167.13878
referencechebi:17612
Image of MNXM645
InChIKeyCFFZDZCDUFSOFZ-UHFFFAOYSA-M
InChIInChI=1S/C8H8O4/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1
SMILESOc1ccc(CC([O-])=O)cc1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref30
Distinct compatimentalized reactions in models14

Similar chemical compounds in external resources
IdentifierDescription
chebi:41941 3,4-dihydroxyphenylacetic acid
(3,4-dihydroxyphenyl)acetic acid
2-(3,4-DIHYDROXYPHENYL)ACETIC ACID
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetic acid
dopacetic acid
homoprotocatechuic acid
hmdb:HMDB0001336 3,4-Dihydroxybenzeneacetic acid
(3,4-Dihydroxyphenyl)-acetic acid
(3,4-Dihydroxyphenyl)acetate
(3,4-Dihydroxyphenyl)acetic acid
2-(3,4-DIHYDROXYPHENYL)acetIC ACID
2-(3,4-DIHYDROXYPHENYL)acetate
2-(3,4-dihydroxyphenyl)acetic acid
3,4 Dihydroxyphenylacetic acid
3,4 dihydroxyphenylacetic acid
3,4-DHPOP
3,4-Dihydroxy-benzeneacetic acid
3,4-Dihydroxy-phenylacetic acid
3,4-Dihydroxybenzeneacetate
3,4-Dihydroxyphenyl acetate
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenylacetic acid
3,4-Dihydroxyphenylacetic acid, monosodium salt
DHY
DOPAC
Dihydroxyphenylacetate
Dihydroxyphenylacetic acid
Dopacetate
Dopacetic acid
HAA
Homogentisic acid
Homoprotocatechuate
Homoprotocatechuic acid
seedM:cpd00854 Homoprotocatechuate
3,4-Dihydroxyphenyl acetate
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenylacetic acid
3,4-dihydroxyphenylacetate
3,4-dihydroxyphenylacetic acid
34dhpha
dihydroxyphenylacetic acid
homoprotocatechuate
biggM:M_34dhpacet
biggM:M_34dhpha
chebi:11696
chebi:11697
chebi:1386
chebi:19889
chebi:41936
hmdb:HMDB01336
keggC:M_C01161
seedM:M_cpd00854
secondary/obsolete/fantasy identifier
biggM:34dhpacet
biggM:34dhpha
3-4-Dihydroxyphenylacetate
keggC:C01161 3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenylacetic acid
Homoprotocatechuate
envipath:...976a15bf65aa compound 1005
sabiorkM:5413 3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenyl acetate
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetic acid
Homoprotocatechuate
metacycM:CPD-782 (3,4-dihydroxyphenyl)acetate
(3,4-dihydroxyphenyl)acetic acid
(dihydroxyphenyl)acetic acid
homoprotocatechuate
chebi:17612 3,4-dihydroxyphenylacetate
(3,4-dihydroxyphenyl)acetate
homoprotocatechuate
envipath:...c652a8465767 3,4-Dihydroxyphenylacetate
MNXM147377is deprecated and replaced by this entry
MNXM481994is deprecated and replaced by this entry
MNXM723718is deprecated and replaced by this entry