Feedback

3,4-dihydroxyphenylacetate

PropertiesImageOccurences in reactions
MNX_IDMNXM645Image of MNXM645
#reac
in my sandbox 0
in MNXref (generic)30
in models (compartimentalized) 14
formulaC8H7O4
charge-1
mass167.13878
referencechebi:17612
InChIKeyCFFZDZCDUFSOFZ-UHFFFAOYSA-M
InChIInChI=1S/C8H8O4/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1
SMILESOc1ccc(CC([O-])=O)cc1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17612
chebi:17612
3,4-dihydroxyphenylacetate
(3,4-dihydroxyphenyl)acetate
homoprotocatechuate
metacyc.compound:CPD-782
metacycM:CPD-782
(3,4-dihydroxyphenyl)acetate
(3,4-dihydroxyphenyl)acetic acid
(dihydroxyphenyl)acetic acid
homoprotocatechuate
hmdb:HMDB0001336 3,4-Dihydroxybenzeneacetic acid
(3,4-Dihydroxyphenyl)-acetic acid
(3,4-Dihydroxyphenyl)acetate
(3,4-Dihydroxyphenyl)acetic acid
2-(3,4-DIHYDROXYPHENYL)acetIC ACID
2-(3,4-DIHYDROXYPHENYL)acetate
2-(3,4-dihydroxyphenyl)acetic acid
3,4 Dihydroxyphenylacetic acid
3,4 dihydroxyphenylacetic acid
3,4-DHPOP
3,4-Dihydroxy-benzeneacetic acid
3,4-Dihydroxy-phenylacetic acid
3,4-Dihydroxybenzeneacetate
3,4-Dihydroxyphenyl acetate
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenylacetic acid
3,4-Dihydroxyphenylacetic acid, monosodium salt
DHY
DOPAC
Dihydroxyphenylacetate
Dihydroxyphenylacetic acid
Dopacetate
Dopacetic acid
HAA
Homogentisic acid
Homoprotocatechuate
Homoprotocatechuic acid
envipath:...c652a8465767
envipathM:...c652a8465767
3,4-Dihydroxyphenylacetate
sabiork.compound:5413
sabiorkM:5413
3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenyl acetate
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetic acid
Homoprotocatechuate
kegg.compound:C01161
keggC:C01161
3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenylacetic acid
Homoprotocatechuate
CHEBI:41941
chebi:41941
3,4-dihydroxyphenylacetic acid
(3,4-dihydroxyphenyl)acetic acid
2-(3,4-DIHYDROXYPHENYL)ACETIC ACID
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetic acid
dopacetic acid
homoprotocatechuic acid
bigg.metabolite:34dhpacet
biggM:34dhpacet
bigg.metabolite:34dhpha
biggM:34dhpha
3-4-Dihydroxyphenylacetate
seed.compound:cpd00854
seedM:cpd00854
Homoprotocatechuate
3,4-Dihydroxyphenyl acetate
3,4-Dihydroxyphenyl acetic acid
3,4-Dihydroxyphenylacetate
3,4-Dihydroxyphenylacetic acid
3,4-dihydroxyphenylacetate
3,4-dihydroxyphenylacetic acid
34dhpha
dihydroxyphenylacetic acid
homoprotocatechuate
envipath:...976a15bf65aa
envipathM:...976a15bf65aa
compound 1005
hmdb:HMDB01336
chebi:11696
chebi:11697
chebi:1386
chebi:19889
chebi:41936
biggM:M_34dhpacet
biggM:M_34dhpha
keggC:M_C01161
seedM:M_cpd00854
secondary/obsolete/fantasy identifier