|
|
|||||||||||||
| InChIKey | CFFZDZCDUFSOFZ-UHFFFAOYSA-M |
| InChI | InChI=1S/C8H8O4/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1 |
| SMILES | Oc1ccc(CC([O-])=O)cc1O |
| #reac | |
|---|---|
| Distinct reactions in my sandbox | 0 |
| Distinct generic reactions in MNXref | 30 |
| Distinct compatimentalized reactions in models | 14 |
| Identifier | Description |
|---|---|
| keggC:C01161 | 3,4-Dihydroxyphenylacetate 3,4-Dihydroxyphenylacetic acid Homoprotocatechuate |
| hmdb:HMDB0001336 | 3,4-Dihydroxybenzeneacetic acid (3,4-Dihydroxyphenyl)-acetic acid (3,4-Dihydroxyphenyl)acetate (3,4-Dihydroxyphenyl)acetic acid 2-(3,4-DIHYDROXYPHENYL)acetIC ACID 2-(3,4-DIHYDROXYPHENYL)acetate 2-(3,4-dihydroxyphenyl)acetic acid 3,4 Dihydroxyphenylacetic acid 3,4 dihydroxyphenylacetic acid 3,4-DHPOP 3,4-Dihydroxy-benzeneacetic acid 3,4-Dihydroxy-phenylacetic acid 3,4-Dihydroxybenzeneacetate 3,4-Dihydroxyphenyl acetate 3,4-Dihydroxyphenyl acetic acid 3,4-Dihydroxyphenylacetate 3,4-Dihydroxyphenylacetic acid 3,4-Dihydroxyphenylacetic acid, monosodium salt DHY DOPAC Dihydroxyphenylacetate Dihydroxyphenylacetic acid Dopacetate Dopacetic acid HAA Homogentisic acid Homoprotocatechuate Homoprotocatechuic acid |
| seedM:cpd00854 | Homoprotocatechuate 3,4-Dihydroxyphenyl acetate 3,4-Dihydroxyphenyl acetic acid 3,4-Dihydroxyphenylacetate 3,4-Dihydroxyphenylacetic acid 3,4-dihydroxyphenylacetate 3,4-dihydroxyphenylacetic acid 34dhpha dihydroxyphenylacetic acid homoprotocatechuate |
| biggM:M_34dhpacet biggM:M_34dhpha chebi:11696 chebi:11697 chebi:1386 chebi:19889 chebi:41936 hmdb:HMDB01336 keggC:M_C01161 seedM:M_cpd00854 | secondary/obsolete/fantasy identifier |
| chebi:41941 | 3,4-dihydroxyphenylacetic acid (3,4-dihydroxyphenyl)acetic acid 2-(3,4-DIHYDROXYPHENYL)ACETIC ACID 3,4-Dihydroxyphenyl acetic acid 3,4-Dihydroxyphenylacetic acid dopacetic acid homoprotocatechuic acid |
| chebi:17612 | 3,4-dihydroxyphenylacetate (3,4-dihydroxyphenyl)acetate homoprotocatechuate |
| biggM:34dhpacet biggM:34dhpha | 3-4-Dihydroxyphenylacetate |
| envipath:...976a15bf65aa | compound 1005 |
| sabiorkM:5413 | 3,4-Dihydroxyphenylacetate 3,4-Dihydroxyphenyl acetate 3,4-Dihydroxyphenyl acetic acid 3,4-Dihydroxyphenylacetic acid Homoprotocatechuate |
| metacycM:CPD-782 | (3,4-dihydroxyphenyl)acetate (3,4-dihydroxyphenyl)acetic acid (dihydroxyphenyl)acetic acid homoprotocatechuate |
| envipath:...c652a8465767 | 3,4-Dihydroxyphenylacetate |
| MNXM147377 | is deprecated and replaced by this entry |
| MNXM481994 | is deprecated and replaced by this entry |
| MNXM723718 | is deprecated and replaced by this entry |
