Feedback

2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)-pyrimidine

Properties
MNX_IDMNXM648
formulaC9H14N5O8P
charge-2
mass351.210121
referencechebi:58614
Image of MNXM648
InChIKeyOCLCLRXKNJCOJD-UMMCILCDSA-L
InChIInChI=1S/C9H16N5O8P/c10-3-6(13-9(11)14-7(3)17)12-8-5(16)4(15)2(22-8)1-21-23(18,19)20/h2,4-5,8,15-16H,1,10H2,(H2,18,19,20)(H4,11,12,13,14,17)/p-2/t2-,4-,5-,8-/m1/s1
SMILESNc1nc(O)c(N)c(N[C@@H]2O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H]2O)n1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
sabiorkM:5518 2,5-Diamino-6-hydroxy-4-(5'-phosphoribosylamino)-pyrimidine
biggM:25drapp 2,5-Diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate
chebi:29114 2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine
1-deoxy-1-[(2,5-diamino-6-hydroxypyrimidin-3-yl)amino]-beta-D-ribofuranose 5-(dihydrogen phosphate)
2,5-Diamino-6-hydroxy-4-(5'-phosphoribosylamino)-pyrimidine
2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine
N-(2,5-diamino-6-hydroxypyrimidin-4-yl)-5-O-phosphono-beta-D-ribofuranosylamine
metacycM:DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR 2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate
2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine
DARP
chebi:59546 2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-Diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(1-D-ribosylamino)-4(3H)-pyrimidinone 5'-phosphate
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-monophosphate
2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one
2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-monophosphate
2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate
APy
N-(2,5-diamino-6-oxo-1,6-dihydropyrimidin-4-yl)-5-O-phosphono-beta-D-ribofuranosylamine
biggM:M_25dhpp
biggM:M_25drapp
chebi:11446
chebi:19368
chebi:927
keggC:M_C01304
secondary/obsolete/fantasy identifier
chebi:58614 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)-pyrimidine
1-deoxy-1-[(2,5-diamino-6-hydroxypyrimidin-3-yl)amino]-beta-D-ribofuranose 5-phosphate
2,5-diamino-4-hydroxy-6-(5-phosphonatoribosylamino)pyrimidine(3-)
N-(2,5-diamino-6-hydroxypyrimidin-4-yl)-5-O-phosphonato-beta-D-ribofuranosylamine
chebi:59545 2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-monophosphate(2-)
2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate(2-)
2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one(2-)
APy(2-)
N-(2,5-diamino-6-oxo-1,6-dihydropyrimidin-4-yl)-5-O-phosphonato-beta-D-ribofuranosylamine
keggC:C01304 2,5-Diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one
2,5-Diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
biggM:25dhpp 2 5 Diamino 6 hydroxy 4 5 phosphoribosylamino pyrimidine
MNXM90906is deprecated and replaced by this entry
MNXM9771is deprecated and replaced by this entry