Feedback

2-dehydro-3-deoxy-6-phospho-D-gluconate

PropertiesImageOccurences in reactions
MNX_IDMNXM649Image of MNXM649
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 4
formulaC6H8O9P
charge-3
mass255.096081
referencechebi:57569
InChIKeyOVPRPPOVAXRCED-WVZVXSGGSA-K
InChIInChI=1S/C6H11O9P/c7-3(1-4(8)6(10)11)5(9)2-15-16(12,13)14/h3,5,7,9H,1-2H2,(H,10,11)(H2,12,13,14)/p-3/t3-,5+/m0/s1
SMILESO[C@H](COP([O-])([O-])=O)[C@@H](O)CC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57569
chebi:57569
2-dehydro-3-deoxy-6-phospho-D-gluconate
(4S,5R)-4,5-dihydroxy-2-oxo-6-(phosphonatooxy)hexanoate
2-dehydro-3-deoxy-6-phosphonato-D-gluconate(3-)
2-keto-3-deoxy-6-phosphonato-D-gluconate(3-)
3-deoxy-6-O-phosphonato-D-erythro-hex-2-ulosonate
kegg.compound:C04442
keggC:C04442
2-Dehydro-3-deoxy-6-phospho-D-gluconate
2-Dehydro-3-deoxy-D-gluconate 6-phosphate
2-Keto-3-deoxy-6-phosphogluconate
6-Phospho-2-dehydro-3-deoxy-D-gluconate
bigg.metabolite:2ddg6p
biggM:2ddg6p
2-Dehydro-3-deoxy-D-gluconate 6-phosphate
seed.compound:cpd02711
seedM:cpd02711
2-Keto-3-deoxy-6-phosphogluconate
2-Dehydro-3-deoxy-6-phospho-D-gluconate
2-Dehydro-3-deoxy-D-gluconate 6-phosphate
2-Dehydro-3-deoxy-D-gluconate6-phosphate
2-dehydro-3-deoxy-6-phospho-D-gluconate
2-dehydro-3-deoxy-D-gluconate 6-phosphate
2-dehydro-3-deoxy-D-gluconate-6-phosphate
2-keto-3-deoxy-6-P-gluconate
2-keto-3-deoxy-6-phospho-D-gluconate
2-keto-3-deoxy-6-phospho-gluconate
2-keto-3-deoxy-6-phosphogluconate
2-keto-3-deoxygluconate-6-P
2ddg6p
3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate
3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate
6-Phospho-2-dehydro-3-deoxy-D-gluconate
6-p-2-k-3-deo-gluconate
6-phospho-2-dehydro-3-deoxy-D-gluconate
6-phospho-2-dehydro-3-deoxygluconate
6-phospho-2-keto-3-deoxygluconate
KDGP
KDPG
hmdb:HMDB0001376 2-Keto-3-deoxy-6-phosphogluconic acid
(4S,5R)-4,5-dihydroxy-2-oxo-6-(phosphonooxy)hexanoic acid
2-dehydro-3-Deoxy-6-phospho-D-gluconate
2-dehydro-3-Deoxy-6-phospho-D-gluconic acid
2-dehydro-3-Deoxy-D-gluconate 6-phosphate
2-dehydro-3-Deoxy-D-gluconate-6-phosphate
2-dehydro-3-Deoxy-D-gluconic acid 6-phosphoric acid
2-keto-3-Deoxy-6-P-gluconate
2-keto-3-Deoxy-6-phospho-gluconate
2-keto-3-Deoxy-6-phosphogluconate
2-keto-3-Deoxygluconate-6-P
3-Deoxy-D-erythro-hex-2-ulosonate 6-phosphate
3-Deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate
3-Deoxy-D-erythro-hex-2-ulosonic acid 6-phosphoric acid
6-P-2-K-3-deo-Gluconate
6-phospho-2-dehydro-3-Deoxy-D-gluconate
6-phospho-2-dehydro-3-Deoxy-D-gluconic acid
6-phospho-2-dehydro-3-Deoxygluconate
6-phospho-2-keto-3-Deoxygluconate
KDPG Intermediate
KDPG Intermediic acid
kdpg intermediate
CHEBI:15925
chebi:15925
2-dehydro-3-deoxy-6-phospho-D-gluconic acid
2-Dehydro-3-deoxy-6-phospho-D-gluconate
2-Dehydro-3-deoxy-D-gluconate 6-phosphate
2-Keto-3-deoxy-6-phosphogluconate
2-dehydro-3-deoxy-6-phospho-D-gluconate
2-dehydro-3-deoxy-D-gluconate 6-phosphate
2-keto-3-deoxy-6-phosphogluconate
3-Deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate
3-deoxy-6-O-phosphono-D-erythro-hex-2-ulosonic acid
6-Phospho-2-dehydro-3-deoxy-D-gluconate
6-phospho-2-dehydro-3-deoxy-D-gluconate
Kdpg intermediate
metacyc.compound:2-KETO-3-DEOXY-6-P-GLUCONATE
metacycM:2-KETO-3-DEOXY-6-P-GLUCONATE
2-dehydro-3-deoxy-D-gluconate 6-phosphate
2-dehydro-3-deoxy-6-phospho-D-gluconate
2-keto-3-deoxy-6-P-gluconate
2-keto-3-deoxy-6-phospho-D-gluconate
2-keto-3-deoxy-6-phospho-gluconate
2-keto-3-deoxy-6-phosphogluconate
2-keto-3-deoxygluconate-6-P
3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate
3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate
6-p-2-k-3-deo-gluconate
6-phospho-2-dehydro-3-deoxy-D-gluconate
6-phospho-2-dehydro-3-deoxygluconate
6-phospho-2-keto-3-deoxygluconate
KDGP
KDPG
hmdb:HMDB01376
chebi:1051
chebi:11543
chebi:11551
chebi:12227
chebi:19522
biggM:M_2ddg6p
keggC:M_C04442
seedM:M_cpd02711
secondary/obsolete/fantasy identifier