Feedback

(R)-3-hydroxybutanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM663Image of MNXM663
#reac
in my sandbox 0
in MNXref (generic)30
in models (compartimentalized) 30
formulaC4H7O3
charge-1
mass103.09658
referencechebi:10983
InChIKeyWHBMMWSBFZVSSR-GSVOUGTGSA-M
InChIInChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1/t3-/m1/s1
SMILESC[C@@H](O)CC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:10983
chebi:10983
(R)-3-hydroxybutanoate
(3R)-3-hydroxybutanoate
(R)-(-)-beta-hydroxybutyrate
(R)-3-Hydroxybutanoate
(R)-3-hydroxybutyrate
3-D-hydroxybutyrate
D-3-hydroxybutyrate
D-beta-hydroxybutyrate
bigg.metabolite:bhb
biggM:bhb
(R)-3-Hydroxybutanoate
seed.compound:cpd00797
seedM:cpd00797
(R)-3-Hydroxybutanoate
(R)-3-Hydroxybutanoic acid
(R)-3-Hydroxybutyric acid
(R)-3-hydroxybutanoate
(R)-3-hydroxybutanoic acid
(R)-3-hydroxybutyrate
(R)-3-hydroxybutyric acid
D-3-hydroxybutyrate
D-beta-Hydroxybutyric acid
D-beta-hydroxybutyrate
b-hydroxybutyric acid
beta-hydroxybutyric acid
bhb
kegg.compound:C01089
keggC:C01089
(R)-3-Hydroxybutanoate
(R)-3-Hydroxybutanoic acid
(R)-3-Hydroxybutyric acid
D-beta-Hydroxybutyric acid
sabiork.compound:2245
sabiorkM:2245
(R)-3-Hydroxybutanoate
(R)-3-Hydroxybutanoic acid
(R)-3-Hydroxybutyric acid
beta-D-Hydroxybutyrate
hmdb:HMDB0000011 (R)-3-Hydroxybutyric acid
(-)-3-hydroxybutyric acid
(3R)-3-hydroxybutanoic acid
(R)-(-)-b-Hydroxybutyrate
(R)-(-)-b-Hydroxybutyric acid
(R)-(-)-beta-Hydroxybutyrate
(R)-(-)-beta-Hydroxybutyric acid
(R)-(-)-beta-hydroxybutyrate
(R)-(-)-beta-hydroxybutyric acid
(R)-3-Hydroxybutanoate
(R)-3-Hydroxybutanoic acid
(R)-3-Hydroxybutyrate
3-D-Hydroxybutyrate
3-D-Hydroxybutyric acid
3-delta-Hydroxybutyrate
3-delta-Hydroxybutyric acid
BHIB
D-(-)-3-Hydroxybutyrate
D-3-Hydroxybutyrate
D-3-Hydroxybutyric acid
D-beta-Hydroxybutyrate
delta-(-)-3-Hydroxybutyrate
delta-3-Hydroxybutyrate
delta-3-Hydroxybutyric acid
delta-beta-Hydroxybutyrate
metacyc.compound:CPD-335
metacycM:CPD-335
(R)-3-hydroxybutanoate
(R)-3-hydroxybutanoic acid
(R)-3-hydroxybutyrate
(R)-3-hydroxybutyric acid
D-3-hydroxybutyrate
D-beta-hydroxybutyrate
b-hydroxybutyric acid
beta-hydroxybutyric acid
reactome:R-ALL-73911
reactomeM:R-ALL-73911
CHEBI:17066
chebi:17066
(R)-3-hydroxybutyric acid
(3R)-3-hydroxybutanoic acid
(R)-(-)-beta-hydroxybutyric acid
(R)-3-Hydroxybutanoic acid
(R)-3-Hydroxybutyric acid
3-D-hydroxybutyric acid
D-3-hydroxybutyric acid
lipidmaps:LMFA01050243
lipidmapsM:LMFA01050243
3R-hydroxy-butanoic acid
(-)-3-Hydroxy-n-butyric acid
(-)-3-Hydroxybutyric acid
(R)-(-)-3-Hydroxybutyric acid
(R)-(-)-beta-Hydroxybutyric acid
(R)-3-
(R)-beta-Hydroxybutanoic acid
(R)-beta-Hydroxybutyric acid
3R-hydroxy-butanoic acid
Butanoic acid, 3-hydroxy-, (R)-
Butyric acid, 3-hydroxy-, D-(-)-
FA(4:0(OH))
hmdb:HMDB00011
chebi:18666
chebi:322
biggM:M_bhb
keggC:M_C01089
seedM:M_cpd00797
secondary/obsolete/fantasy identifier