Feedback

5,10-methylenetetrahydromethanopterin

Properties
MNX_IDMNXM667
formulaC31H42N6O16P
charge-3
mass785.669781
referencechebi:57818
Image of MNXM667
InChIKeyGBMIGEWJAPFSQI-CAFBYHECSA-K
InChIInChI=1S/C31H45N6O16P/c1-13-22-14(2)36(12-37(22)23-27(33-13)34-31(32)35-28(23)45)16-5-3-15(4-6-16)9-17(38)24(42)18(39)10-50-30-26(44)25(43)20(52-30)11-51-54(48,49)53-19(29(46)47)7-8-21(40)41/h3-6,13-14,17-20,22,24-26,30,38-39,42-44H,7-12H2,1-2H3,(H,40,41)(H,46,47)(H,48,49)(H4,32,33,34,35,45)/p-3/t13-,14+,17-,18+,19-,20+,22+,24-,25+,26+,30-/m0/s1
SMILESC[C@@H]1[C@H]2[C@H](C)Nc3nc(N)[nH]c(=O)c3N2CN1c1ccc(C[C@H](O)[C@H](O)[C@H](O)CO[C@H]2O[C@H](COP([O-])(=O)O[C@@H](CCC([O-])=O)C([O-])=O)[C@@H](O)[C@H]2O)cc1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref24
Distinct compatimentalized reactions in models2

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0060401 5,10-Methylenetetrahydromethanopterin
(2S)-2-({[(2R,3S,4R,5S)-5-{[(2R,3S,4S)-5-{4-[(6S,6aR,7R)-1-hydroxy-3-imino-6,7-dimethyl-4H,5H,6H,6aH,7H,9H-imidazolidino[1,5-f]pteridin-8-yl]phenyl}-2,3,4-trihydroxypentyl]oxy}-3,4-dihydroxyoxolan-2-yl]methoxy(hydroxy)phosphoryl}oxy)pentanedioic acid
(2S)-2-[({[(2R,3S,4R,5S)-5-{[(2R,3S,4S)-5-{4-[(6S,6aR,7R)-1-hydroxy-3-imino-6,7-dimethyl-3H,4H,5H,6H,6aH,7H,8H,9H-imidazolidino[1,5-f]pteridin-8-yl]phenyl}-2,3,4-trihydroxypentyl]oxy}-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]pentanedioic acid
N5,N10-Methylenetetrahydromethanopterin
seedM:cpd02679 5,10-Methylenetetrahydromethanopterin
5,10-methylene-5,6,7,8-tetrahydromethanopterin
5,10-methylene-H4MPT
5,10-methylene-tetrahydromethanopterin
N5,N10-Methylenetetrahydromethanopterin
N5,N10-methylene-5,6,7,8-tetrahydromethanopterin
N5,N10-methylenetetrahydromethanopterin
methylene-H4MPT
metacycM:METHYLENETETRAHYDROMETHANOPTERIN 5,10-methylene-tetrahydromethanopterin
5,10-methylene-5,6,7,8-tetrahydromethanopterin
5,10-methylene-H4MPT
N5,N10-methylene-5,6,7,8-tetrahydromethanopterin
N5,N10-methylenetetrahydromethanopterin
methylene-H4MPT
keggC:C04377
sabiorkM:7269
5,10-Methylenetetrahydromethanopterin
N5,N10-Methylenetetrahydromethanopterin
chebi:57818 5,10-methylenetetrahydromethanopterin
1-{4-[(6S,6aR,7R)-3-amino-6,7-dimethyl-1-oxo-1,2,5,6,6a,7-hexahydroimidazo[1,5-f]pteridin-8(9H)-yl]phenyl}-1-deoxy-5-O-[5-O-({[(1S)-1,3-dicarboxylatopropyl]oxy}phosphinato)-alpha-D-ribofuranosyl]-D-ribitol
5,10-methylenetetrahydromethanopterin trianion
5,10-methylenetetrahydromethanopterin(3-)
chebi:16568 5,10-methylenetetrahydromethanopterin
1-{4-[(6S,6aR,7R)-3-amino-6,7-dimethyl-1-oxo-1,2,5,6,6a,7-hexahydroimidazo[1,5-f]pteridin-8(9H)-yl]phenyl}-1-deoxy-5-O-(5-O-{[(1S)-1,3-dicarboxypropoxy](hydroxy)phosphoryl}-alpha-D-ribofuranosyl)-D-ribitol
5,10-Methylenetetrahydromethanopterin
N5,N10-Methylenetetrahydromethanopterin
chebi:12072
chebi:12648
chebi:1990
chebi:20504
hmdb:HMDB60401
keggC:M_C04377
seedM:M_cpd02679
secondary/obsolete/fantasy identifier