Feedback

3,4,5-trihydroxybenzoate

Properties
MNX_IDMNXM670
formulaC7H5O5
charge-1
mass169.1116
referencechebi:16918
Image of MNXM670
InChIKeyLNTHITQWFMADLM-UHFFFAOYSA-M
InChIInChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12)/p-1
SMILESOc1cc(cc(O)c1O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref22
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-183 gallate
3,4,5-trihydroxybenzoate
3,4,5-trihydroxybenzoic acid
gallic acid
pyrogallol-5-carboxylate
pyrogallol-5-carboxylic acid
keggC:C01424
sabiorkM:5573
Gallate
3,4,5-Trihydroxybenzoate
3,4,5-Trihydroxybenzoic acid
Gallic acid
Pyrogallol-5-carboxylic acid
chebi:16918 3,4,5-trihydroxybenzoate
gallate
hmdb:HMDB0005807 Gallic acid
3,4,5-Trihydroxy-benzoate
3,4,5-Trihydroxy-benzoic acid
3,4,5-Trihydroxybenzoate
3,4,5-Trihydroxybenzoic acid
3,4,5-Trihydroxybenzoic acid (acd/name 4.0)
3,4,5-trihydroxybenzoic acid
Acid, gallic
Gallate
Gallic acid polymer
Gallic acid tech.
Galop
Pyrogallol-5-carboxylate
Pyrogallol-5-carboxylic acid
galop
biggM:ga Gallic acid
chebi:30778 gallic acid
3,4,5-Trihydroxybenzoic acid
3,4,5-trihydroxybenzoic acid
Gallic acid
Pyrogallol-5-carboxylic acid
envipath:...86304bed05ad Gallate
biggM:M_ga
chebi:11686
chebi:14291
chebi:24178
chebi:24180
chebi:5268
hmdb:HMDB05807
keggC:M_C01424
seedM:M_cpd01020
secondary/obsolete/fantasy identifier
seedM:cpd01020 Gallate
3,4,5-Trihydroxybenzoate
3,4,5-Trihydroxybenzoic acid
3,4,5-trihydroxybenzoate
3,4,5-trihydroxybenzoic acid
Gallic acid
Pyrogallol-5-carboxylic acid
ga
gallate
gallic acid
pyrogallol-5-carboxylate
pyrogallol-5-carboxylic acid