Feedback

3,4,5-trihydroxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM670Image of MNXM670
#reac
in my sandbox 0
in MNXref (generic)20
in models (compartimentalized) 4
formulaC7H5O5
charge-1
mass169.1116
referencechebi:16918
InChIKeyLNTHITQWFMADLM-UHFFFAOYSA-M
InChIInChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12)/p-1
SMILESOc1cc(cc(O)c1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16918
chebi:16918
3,4,5-trihydroxybenzoate
gallate
envipath:...86304bed05ad
envipathM:...86304bed05ad
Gallate
seed.compound:cpd01020
seedM:cpd01020
Gallate
3,4,5-Trihydroxybenzoate
3,4,5-Trihydroxybenzoic acid
3,4,5-trihydroxybenzoate
3,4,5-trihydroxybenzoic acid
Gallic acid
Pyrogallol-5-carboxylic acid
ga
gallate
gallic acid
pyrogallol-5-carboxylate
pyrogallol-5-carboxylic acid
sabiork.compound:5573
sabiorkM:5573
kegg.compound:C01424
keggC:C01424
Gallate
3,4,5-Trihydroxybenzoate
3,4,5-Trihydroxybenzoic acid
Gallic acid
Pyrogallol-5-carboxylic acid
bigg.metabolite:ga
biggM:ga
Gallic acid
hmdb:HMDB0005807 Gallic acid
3,4,5-Trihydroxy-benzoate
3,4,5-Trihydroxy-benzoic acid
3,4,5-Trihydroxybenzoate
3,4,5-Trihydroxybenzoic acid
3,4,5-Trihydroxybenzoic acid (acd/name 4.0)
3,4,5-trihydroxybenzoic acid
Acid, gallic
Gallate
Gallic acid polymer
Gallic acid tech.
Galop
Pyrogallol-5-carboxylate
Pyrogallol-5-carboxylic acid
galop
metacyc.compound:CPD-183
metacycM:CPD-183
gallate
3,4,5-trihydroxybenzoate
3,4,5-trihydroxybenzoic acid
gallic acid
pyrogallol-5-carboxylate
pyrogallol-5-carboxylic acid
CHEBI:30778
chebi:30778
gallic acid
3,4,5-Trihydroxybenzoic acid
3,4,5-trihydroxybenzoic acid
Gallic acid
Pyrogallol-5-carboxylic acid
hmdb:HMDB05807
chebi:11686
chebi:14291
chebi:24178
chebi:24180
chebi:5268
biggM:M_ga
keggC:M_C01424
seedM:M_cpd01020
secondary/obsolete/fantasy identifier