Feedback

L-pipecolate

Properties
MNX_IDMNXM684
formulaC6H11NO2
charge0
mass129.15708
referencechebi:61185
Image of MNXM684
InChIKeyHXEACLLIILLPRG-YFKPBYRVSA-N
InChIInChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)/t5-/m0/s1
SMILES[O-]C(=O)[C@@H]1CCCC[NH2+]1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref21
Distinct compatimentalized reactions in models10

Similar chemical compounds in external resources
IdentifierDescription
chebi:61185 L-pipecolate
(2S)-piperidinium-2-carboxylate
(S)-2-carboxypiperidinium betaine
L-pipecolic acid zwitterion
chebi:30633 L-pipecolate
(2S)-piperidine-2-carboxylate
(S)-pipecolate
L-Pipecolate
metacycM:L-PIPECOLATE L-pipecolate
(S)-pipecolate
(S)-pipecolic acid
L-pipecolic acid
hmdb:HMDB0000716 L-Pipecolic acid
(-)-Pipecolate
(-)-Pipecolic acid
(2S)-piperidine-2-carboxylic acid
(S)-(-)-2-Piperidinecarboxylate
(S)-(-)-2-Piperidinecarboxylic acid
(S)-(-)-Pipecolate
(S)-(-)-Pipecolic acid
(S)-2-Piperidinecarboxylate
(S)-2-Piperidinecarboxylic acid
(S)-Pipecolate
(S)-Pipecolic acid
(S)-Pipecolinate
(S)-Pipecolinic acid
(S)-Piperidine-2-carboxylate
(S)-Piperidine-2-carboxylic acid
2-Piperidinecarboxylate
2-Piperidinecarboxylic acid
Homopipecolic acid
L-(-)-Pipecolate
L-(-)-Pipecolic acid
L-Homoproline
L-Pipecolate
L-Pipecolinate
L-Pipecolinic acid
L-Piperidine-2-carboxylate
L-Piperidine-2-carboxylic acid
L-pipecolic acid
Pipecolate
Pipecolic acid
Pipecolic acid hydrochloride, (+-)-isomer
Pipecolic acid, (+,-)-isomer
Pipecolic acid, (R)-isomer
Pipecolic acid, (S)-isomer
Pipecolic acid, 14C-labeled CPD, (+,-)-isomer
Pipecolic acid, ion (1-)
Pipecolic acid, ion(1-), (+,-)-isomer
Pipecolic acid, ion(1-), (S)-isomer
Pipecolic acid, monopotassium salt
Pipecolinate
Pipecolinic acid
keggC:C00408 L-Pipecolate
(S)-Piperidine-2-carboxylic acid
2-Piperidinecarboxylic acid
Pipecolic acid
Pipecolinic acid
chebi:30913 L-pipecolic acid
(2S)-piperidine-2-carboxylic acid
(S)-(-)-pipecolic acid
(S)-pipecolic acid
(S)-piperidine-2-carboxylic acid
2-Piperidinecarboxylic acid
L-(-)-pipecolic acid
Pipecolic acid
Pipecolinic acid
sabiorkM:5075 L-Pipecolate
2-Piperidinecarboxylic acid
Pipecolic acid
Pipecolinic acid
biggM:M_Lpipecol
chebi:13153
chebi:18796
chebi:18797
chebi:6284
hmdb:HMDB00716
keggC:M_C00408
seedM:M_cpd00323
secondary/obsolete/fantasy identifier
biggM:Lpipecol L-pipecolic acid
piperidine-2-carboxylic acid
seedM:cpd00323 L-Pipecolate
(S)-Piperidine-2-carboxylic acid
(S)-pipecolate
(S)-pipecolic acid
(S)-piperidine-2-carboxylate
2-Piperidinecarboxylic acid
L-pipecolate
L-pipecolic acid
Lpipecol
Pipecolic acid
Pipecolinic acid
piperidine-2-carboxylate
MNXM90475is deprecated and replaced by this entry