Feedback

L-pipecolate

PropertiesImageOccurences in reactions
MNX_IDMNXM684Image of MNXM684
#reac
in my sandbox 0
in MNXref (generic)21
in models (compartimentalized) 10
formulaC6H11NO2
charge0
mass129.15708
referencechebi:61185
InChIKeyHXEACLLIILLPRG-YFKPBYRVSA-N
InChIInChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)/t5-/m0/s1
SMILES[O-]C(=O)[C@@H]1CCCC[NH2+]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:61185
chebi:61185
L-pipecolate
(2S)-piperidinium-2-carboxylate
(S)-2-carboxypiperidinium betaine
L-pipecolic acid zwitterion
seed.compound:cpd00323
seedM:cpd00323
L-Pipecolate
(S)-Piperidine-2-carboxylic acid
(S)-pipecolate
(S)-pipecolic acid
(S)-piperidine-2-carboxylate
2-Piperidinecarboxylic acid
L-pipecolate
L-pipecolic acid
Lpipecol
Pipecolic acid
Pipecolinic acid
piperidine-2-carboxylate
kegg.compound:C00408
keggC:C00408
L-Pipecolate
(S)-Piperidine-2-carboxylic acid
2-Piperidinecarboxylic acid
Pipecolic acid
Pipecolinic acid
sabiork.compound:5075
sabiorkM:5075
L-Pipecolate
2-Piperidinecarboxylic acid
Pipecolic acid
Pipecolinic acid
hmdb:HMDB0000716 L-Pipecolic acid
(-)-Pipecolate
(-)-Pipecolic acid
(2S)-piperidine-2-carboxylic acid
(S)-(-)-2-Piperidinecarboxylate
(S)-(-)-2-Piperidinecarboxylic acid
(S)-(-)-Pipecolate
(S)-(-)-Pipecolic acid
(S)-2-Piperidinecarboxylate
(S)-2-Piperidinecarboxylic acid
(S)-Pipecolate
(S)-Pipecolic acid
(S)-Pipecolinate
(S)-Pipecolinic acid
(S)-Piperidine-2-carboxylate
(S)-Piperidine-2-carboxylic acid
2-Piperidinecarboxylate
2-Piperidinecarboxylic acid
Homopipecolic acid
L-(-)-Pipecolate
L-(-)-Pipecolic acid
L-Homoproline
L-Pipecolate
L-Pipecolinate
L-Pipecolinic acid
L-Piperidine-2-carboxylate
L-Piperidine-2-carboxylic acid
L-pipecolic acid
Pipecolate
Pipecolic acid
Pipecolic acid hydrochloride, (+-)-isomer
Pipecolic acid, (+,-)-isomer
Pipecolic acid, (R)-isomer
Pipecolic acid, (S)-isomer
Pipecolic acid, 14C-labeled CPD, (+,-)-isomer
Pipecolic acid, ion (1-)
Pipecolic acid, ion(1-), (+,-)-isomer
Pipecolic acid, ion(1-), (S)-isomer
Pipecolic acid, monopotassium salt
Pipecolinate
Pipecolinic acid
CHEBI:30633
chebi:30633
L-pipecolate
(2S)-piperidine-2-carboxylate
(S)-pipecolate
L-Pipecolate
metacyc.compound:L-PIPECOLATE
metacycM:L-PIPECOLATE
L-pipecolate
(S)-pipecolate
(S)-pipecolic acid
L-pipecolic acid
CHEBI:30913
chebi:30913
L-pipecolic acid
(2S)-piperidine-2-carboxylic acid
(S)-(-)-pipecolic acid
(S)-pipecolic acid
(S)-piperidine-2-carboxylic acid
2-Piperidinecarboxylic acid
L-(-)-pipecolic acid
Pipecolic acid
Pipecolinic acid
bigg.metabolite:Lpipecol
biggM:Lpipecol
L-pipecolic acid
piperidine-2-carboxylic acid
hmdb:HMDB00716
chebi:13153
chebi:18796
chebi:18797
chebi:6284
biggM:M_Lpipecol
keggC:M_C00408
seedM:M_cpd00323
secondary/obsolete/fantasy identifier