This is version 4.2 of MetaNetX/MNXref
 Feedback

glyoxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM69Image of MNXM69
#reac
in my sandbox 0
in MNXref (generic)148
in models (compartimentalized) 47
formulaC2HO3
charge-1
mass73.02754
referencechebi:36655
InChIKeyHHLFWLYXYJOTON-UHFFFAOYSA-M
InChIInChI=1S/C2H2O3/c3-1-2(4)5/h1H,(H,4,5)/p-1
SMILES[O-]C(=O)C=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:36655
chebi:36655
glyoxylate
Glyoxylat
oxoacetate
seed.compound:cpd00040
seedM:cpd00040
Glyoxalate
Glyoxylate
Glyoxylic acid
glx
glyox
glyoxalate
glyoxylate
glyoxylic acid
bigg.metabolite:glx
biggM:glx
envipath:...d857bfaa198a
envipathM:...d857bfaa198a
Glyoxylate
sabiork.compound:1838
sabiorkM:1838
kegg.compound:C00048
keggC:C00048
Glyoxylate
Glyoxalate
Glyoxylic acid
hmdb:HMDB0000119 Glyoxylic acid
2-oxoacetic acid
Formylformate
Formylformic acid
Glyoxalate
Glyoxalic acid
Glyoxalsaeure
Glyoxylate
Glyoxylic acid, 14c2-labeled
Glyoxylic acid, 2-(14)C-labeled
Glyoxylic acid, calcium salt
Glyoxylic acid, sodium salt
Glyoxylic acid, sodium salt, 14C-labeled
Glyoxylic acid, sodium salt, 2-(14)C-labeled
Glyoxylsaeure
Oxalaldehydate
Oxalaldehydic acid
Oxoacetate
Oxoacetic acid
Oxoethanoate
Oxoethanoic acid
a-Ketoacetate
a-Ketoacetic acid
alpha-Ketoacetate
alpha-Ketoacetic acid
alpha-ketoacetate
alpha-ketoacetic acid
glyoxylic acid
envipath:...501b036f9626
envipathM:...501b036f9626
compound 2530
envipath:...c97d8e9eed48
envipathM:...c97d8e9eed48
compound 37973
envipath:...6a072f4f963c
envipathM:...6a072f4f963c
compound 866
metacyc.compound:GLYOX
metacycM:GLYOX
glyoxylate
glyox
glyoxalate
glyoxylic acid
reactome:R-ALL-389678
reactomeM:R-ALL-389678
reactome:R-ALL-904849
reactomeM:R-ALL-904849
CHEBI:16891
chebi:16891
glyoxylic acid
GLYOXYLIC ACID
Glyoxalate
Glyoxalsaeure
Glyoxylate
Glyoxylic acid
Glyoxylsaeure
alpha-ketoacetic acid
formylformic acid
oxalaldehydic acid
oxoacetic acid
oxoethanoic acid
hmdb:HMDB00119
chebi:14368
chebi:24420
chebi:24421
chebi:35977
chebi:42767
chebi:5509
biggM:M_glx
keggC:M_C00048
seedM:M_cpd00040
secondary/obsolete/fantasy identifier