Feedback

D-serine

PropertiesImageOccurences in reactions
MNX_IDMNXM694Image of MNXM694
#reac
in my sandbox 0
in MNXref (generic)24
in models (compartimentalized) 12
formulaC3H7NO3
charge0
mass105.09262
referencechebi:35247
InChIKeyMTCFGRXMJLQNBG-UWTATZPHSA-N
InChIInChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m1/s1
SMILES[NH3+][C@H](CO)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:35247
chebi:35247
D-serine
(2R)-2-ammonio-3-hydroxypropanoate
D-serine zwitterion
bigg.metabolite:ser__D
biggM:ser__D
sabiork.compound:2144
sabiorkM:2144
kegg.compound:C00740
keggC:C00740
D-Serine
hmdb:HMDB0003406 D-Serine
(2R)-2-amino-3-Hydroxypropanoate
(2R)-2-amino-3-Hydroxypropanoic acid
(2R)-2-amino-3-hydroxypropanoic acid
(R)-2-amino-3-Hydroxy-propionate
(R)-2-amino-3-Hydroxy-propionic acid
(R)-2-amino-3-Hydroxypropanoate
(R)-2-amino-3-Hydroxypropanoic acid
D-Serin
D-serine
DL-Serine
DSN
Serine D-form
seed.compound:cpd00550
seedM:cpd00550
D-Serine
D-serine
ser-D
CHEBI:32840
chebi:32840
D-serinate
(2R)-2-amino-3-hydroxypropanoate
D-serine anion
metacyc.compound:D-SERINE
metacycM:D-SERINE
D-serine
reactome:R-ALL-376186
reactomeM:R-ALL-376186
reactome:R-ALL-376193
reactomeM:R-ALL-376193
CHEBI:16523
chebi:16523
D-serine
(2R)-2-amino-3-hydroxypropanoic acid
(R)-2-Amino-3-hydroxy-propionic acid
(R)-2-amino-3-hydroxypropanoic acid
D-SERINE
D-Serin
D-Serine
DSN
CHEBI:32841
chebi:32841
D-serinium
(1R)-1-carboxy-2-hydroxyethanaminium
D-serine cation
biggM:ser-D
hmdb:HMDB03406
chebi:13019
chebi:143888
chebi:21090
chebi:42262
chebi:4245
biggM:M_ser__D
keggC:M_C00740
seedM:M_cpd00550
secondary/obsolete/fantasy identifier