Feedback

 

3-oxododecanoyl-CoA

Image of MNXM705
Properties
MNX_IDMNXM705
formulaC33H52N7O18P3S
charge-4
mass959.791
referencechebi:62615
InChIKeyHQANBZHVWIDNQZ-GMHMEAMDSA-J
InChIInChI=1S/C33H56N7O18P3S/c1-4-5-6-7-8-9-10-11-21(41)16-24(43)62-15-14-35-23(42)12-13-36-31(46)28(45)33(2,3)18-55-61(52,53)58-60(50,51)54-17-22-27(57-59(47,48)49)26(44)32(56-22)40-20-39-25-29(34)37-19-38-30(25)40/h19-20,22,26-28,32,44-45H,4-18H2,1-3H3,(H,35,42)(H,36,46)(H,50,51)(H,52,53)(H2,34,37,38)(H2,47,48,49)/p-4/t22-,26-,27-,28+,32-/m1/s1
SMILESCCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP([O-])([O-])=O)n1cnc2c(N)ncnc12

This chemical compound does not exist in my selection



Occurrences of 3-oxododecanoyl-CoA in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3oddcoa
kegg:C05263
3-Oxododecanoyl-CoA
chebi:1636
chebi:20169
chebi:27868
3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-{[3-oxo-3-({2-[(3-oxododecanoyl)sulfanyl]ethyl}amino)propyl]amino}butyl] dihydrogen diphosphate}
3-Oxododecanoyl-CoA
3-ketododecanoyl-CoA
3-ketododecanoyl-coenzyme A
3-ketolauroyl-CoA
3-ketolauroyl-coenzyme A
3-oxododecanoyl-coenzyme A
3-oxolauroyl-CoA
3-oxolauroyl-coenzyme A
HQANBZHVWIDNQZ-GMHMEAMDSA-N
chebi:62615 3'-phosphonatoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-{[3-oxo-3-({2-[(3-oxododecanoyl)sulfanyl]ethyl}amino)propyl]amino}butyl] diphosphate}
3-oxododecanoyl-CoA
3-oxododecanoyl-CoA(4-)
3-oxolauroyl-CoA(4-)
HQANBZHVWIDNQZ-GMHMEAMDSA-J
hmdb:HMDB03937
hmdb:HMDB06350
3-Oxododecanoyl-CoA
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[({hydroxy[hydroxy(3-hydroxy-2,2-dimethyl-3-{[2-({2-[(3-oxododecanoyl)sulfanyl]ethyl}carbamoyl)ethyl]carbamoyl}propoxy)phosphoryl]oxyphosphoryl}oxy)methyl]oxolan-3-yl]oxyphosphonic acid
{[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[hydroxy({[hydroxy(3-hydroxy-2,2-dimethyl-3-{[2-({2-[(3-oxododecanoyl)sulfanyl]ethyl}carbamoyl)ethyl]carbamoyl}propoxy)phosphoryl]oxy})phosphoryl]oxy}methyl)oxolan-3-yl]oxy}phosphonic acid
hmdb:HMDB62368 (2R)-4-({[({[(2R,3R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)-2-hydroxy-3,3-dimethyl-N-[2-({2-[(3-oxododecanoyl)sulfanyl]ethyl}-C-hydroxycarbonimidoyl)ethyl]butanimidic acid
(2R)-4-[({[(2R,3R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methoxy(hydroxy)phosphoryl}oxy(hydroxy)phosphoryl)oxy]-2-hydroxy-3,3-dimethyl-N-[2-({2-[(3-oxododecanoyl)sulfanyl]ethyl}-C-hydroxycarbonimidoyl)ethyl]butanimidic acid
3-oxo-dodecanoyl-CoA
lipidmaps:LMFA07050013 3-Oxododecanoyl-CoA
3-oxo-dodecanoyl-CoA
lipidmaps:LMFA07050013
lipidmaps:LMFA07050247 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-{[3-oxo-3-({2-[(3-oxododecanoyl)sulfanyl]ethyl}amino)propyl]amino}butyl] dihydrogen diphosphate}
3-ketododecanoyl-CoA
3-ketododecanoyl-coenzyme A
3-ketolauroyl-CoA
3-ketolauroyl-coenzyme A
3-oxododecanoyl-coenzyme A
3-oxolauroyl-CoA
3-oxolauroyl-coenzyme A
lipidmaps:LMFA07050247
metacyc:CPD0-2105 3-oxododecanoyl-CoA
3-oxolauroyl-CoA
CPD0-2105
reactome:77253 3-Oxododecanoyl-CoA
3-oxolauroyl-CoA
sabiork:2740 3-Ketododecanoyl-CoA
3-Oxododecanoyl-CoA
seed:cpd03117 3-Oxododecanoyl-CoA
3oddcoa
slm:000001024 3-oxododecanoyl-CoA
deprecated:MNXM23400
deprecated:MNXM89943
deprecated:MNXM91421